[(10S,11S,12R,13S,15R)-3,4,5,11,13,21,22,23,26,27,38,39-dodecahydroxy-8,18,30,35-tetraoxo-9,14,17,29,36-pentaoxaoctacyclo[29.8.0.02,7.010,15.019,24.025,34.028,33.032,37]nonatriaconta-1(39),2,4,6,19,21,23,25,27,31,33,37-dodecaen-12-yl] 3,4,5-trihydroxybenzoate
Internal ID | 69261514-2a39-4573-a6ed-0e18d0c497dc |
Taxonomy | Phenylpropanoids and polyketides > Tannins > Hydrolyzable tannins |
IUPAC Name | [(10S,11S,12R,13S,15R)-3,4,5,11,13,21,22,23,26,27,38,39-dodecahydroxy-8,18,30,35-tetraoxo-9,14,17,29,36-pentaoxaoctacyclo[29.8.0.02,7.010,15.019,24.025,34.028,33.032,37]nonatriaconta-1(39),2,4,6,19,21,23,25,27,31,33,37-dodecaen-12-yl] 3,4,5-trihydroxybenzoate |
SMILES (Canonical) | C1C2C(C(C(C(O2)O)OC(=O)C3=CC(=C(C(=C3)O)O)O)O)OC(=O)C4=CC(=C(C(=C4C5=C(C(=C6C7=C5C(=O)OC8=C(C(=C(C9=C(C(=C(C=C9C(=O)O1)O)O)O)C(=C78)C(=O)O6)O)O)O)O)O)O)O |
SMILES (Isomeric) | C1[C@@H]2[C@H]([C@@H]([C@H]([C@H](O2)O)OC(=O)C3=CC(=C(C(=C3)O)O)O)O)OC(=O)C4=CC(=C(C(=C4C5=C(C(=C6C7=C5C(=O)OC8=C(C(=C(C9=C(C(=C(C=C9C(=O)O1)O)O)O)C(=C78)C(=O)O6)O)O)O)O)O)O)O |
InChI | InChI=1S/C41H26O26/c42-9-1-6(2-10(43)22(9)46)36(56)67-35-31(55)32-13(63-41(35)61)5-62-37(57)7-3-11(44)23(47)25(49)14(7)16-20-18-19-21(40(60)66-33(18)29(53)27(16)51)17(28(52)30(54)34(19)65-39(20)59)15-8(38(58)64-32)4-12(45)24(48)26(15)50/h1-4,13,31-32,35,41-55,61H,5H2/t13-,31+,32-,35-,41+/m1/s1 |
InChI Key | GXNAJCYGMNREKO-DVHASCOZSA-N |
Popularity | 0 references in papers |
Molecular Formula | C41H26O26 |
Molecular Weight | 934.60 g/mol |
Exact Mass | 934.07123093 g/mol |
Topological Polar Surface Area (TPSA) | 444.00 Ų |
XlogP | 0.90 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.79% | 91.11% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 98.48% | 91.49% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 94.51% | 89.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 93.98% | 94.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.92% | 95.56% |
CHEMBL3194 | P02766 | Transthyretin | 89.82% | 90.71% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 89.18% | 99.23% |
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 88.78% | 95.17% |
CHEMBL2581 | P07339 | Cathepsin D | 88.72% | 98.95% |
CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 88.19% | 89.34% |
CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 88.10% | 83.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.70% | 95.89% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 87.62% | 97.21% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.53% | 86.33% |
CHEMBL2094127 | P06493 | Cyclin-dependent kinase 1/cyclin B | 86.48% | 96.00% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 86.13% | 96.21% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 86.02% | 96.95% |
CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 84.39% | 94.42% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 83.91% | 99.17% |
CHEMBL4208 | P20618 | Proteasome component C5 | 82.49% | 90.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 82.18% | 97.09% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 82.05% | 100.00% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 81.79% | 91.19% |
CHEMBL3401 | O75469 | Pregnane X receptor | 81.51% | 94.73% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 80.55% | 92.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Punica granatum |
PubChem | 163048086 |
LOTUS | LTS0156442 |
wikiData | Q105023213 |