5,7,2',4'-Tetrahydroxy-6-prenylisoflavanone
Internal ID | 7dab2ecf-1571-48f8-98f3-d861959beba5 |
Taxonomy | Phenylpropanoids and polyketides > Isoflavonoids > Isoflavans > Isoflavanones |
IUPAC Name | 3-(2,4-dihydroxyphenyl)-5,7-dihydroxy-6-(3-methylbut-2-enyl)-2,3-dihydrochromen-4-one |
SMILES (Canonical) | CC(=CCC1=C(C2=C(C=C1O)OCC(C2=O)C3=C(C=C(C=C3)O)O)O)C |
SMILES (Isomeric) | CC(=CCC1=C(C2=C(C=C1O)OCC(C2=O)C3=C(C=C(C=C3)O)O)O)C |
InChI | InChI=1S/C20H20O6/c1-10(2)3-5-13-16(23)8-17-18(19(13)24)20(25)14(9-26-17)12-6-4-11(21)7-15(12)22/h3-4,6-8,14,21-24H,5,9H2,1-2H3 |
InChI Key | AMCPULFLJZMXJI-UHFFFAOYSA-N |
Popularity | 2 references in papers |
Molecular Formula | C20H20O6 |
Molecular Weight | 356.40 g/mol |
Exact Mass | 356.12598835 g/mol |
Topological Polar Surface Area (TPSA) | 107.00 Ų |
XlogP | 4.10 |
5,7,2',4'-Tetrahydroxy-6-prenylisoflavanone |
88899-18-7 |
DTXSID801008562 |
LMPK12050484 |
4H-1-Benzopyran-4-one, 3-(2,4-dihydroxyphenyl)-2,3-dihydro-5,7-dihydroxy-6-(3-methyl-2-butenyl)- |
5,7,2',4'-tetrahydroxy-6-(3-methylbut-2-enyl) isoflavanone |
3-(2,4-Dihydroxyphenyl)-5,7-dihydroxy-6-(3-methylbut-2-en-1-yl)-2,3-dihydro-4H-1-benzopyran-4-one |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.33% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 98.10% | 98.95% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.60% | 94.45% |
CHEMBL3401 | O75469 | Pregnane X receptor | 93.58% | 94.73% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 92.25% | 89.00% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 91.03% | 100.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.41% | 95.56% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.19% | 86.33% |
CHEMBL240 | Q12809 | HERG | 88.62% | 89.76% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.49% | 95.89% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 86.67% | 96.09% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 86.07% | 85.14% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 85.82% | 90.71% |
CHEMBL1929 | P47989 | Xanthine dehydrogenase | 85.19% | 96.12% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 84.51% | 95.93% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 83.15% | 93.40% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 82.23% | 99.23% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 81.68% | 97.09% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 81.39% | 99.17% |
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 81.03% | 95.17% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 80.97% | 99.15% |
CHEMBL5852 | Q96P65 | Pyroglutamylated RFamide peptide receptor | 80.90% | 85.00% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 80.49% | 93.99% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Desmodium uncinatum |
Diphysa americana |
Uraria picta |
PubChem | 180589 |
LOTUS | LTS0248840 |
wikiData | Q83005061 |