[11,16-Diacetyloxy-13-(furan-3-yl)-10-hydroxy-7-(2-methoxy-2-oxoethyl)-6,6,8,12-tetramethyl-4-(2-methylbutanoyloxy)-9,15-dioxospiro[2,14-dioxatetracyclo[8.6.1.01,12.03,8]heptadecane-17,2'-oxirane]-5-yl] pyridine-3-carboxylate;[11,16-diacetyloxy-13-(furan-3-yl)-10-hydroxy-7-(2-methoxy-2-oxoethyl)-6,6,8,12-tetramethyl-5-(2-methylbutanoyloxy)-9,15-dioxospiro[2,14-dioxatetracyclo[8.6.1.01,12.03,8]heptadecane-17,2'-oxirane]-4-yl] pyridine-3-carboxylate
Internal ID | 929e42c5-78bf-4136-9d05-12042a35fc14 |
Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Hexacarboxylic acids and derivatives |
IUPAC Name | [11,16-diacetyloxy-13-(furan-3-yl)-10-hydroxy-7-(2-methoxy-2-oxoethyl)-6,6,8,12-tetramethyl-4-(2-methylbutanoyloxy)-9,15-dioxospiro[2,14-dioxatetracyclo[8.6.1.01,12.03,8]heptadecane-17,2'-oxirane]-5-yl] pyridine-3-carboxylate;[11,16-diacetyloxy-13-(furan-3-yl)-10-hydroxy-7-(2-methoxy-2-oxoethyl)-6,6,8,12-tetramethyl-5-(2-methylbutanoyloxy)-9,15-dioxospiro[2,14-dioxatetracyclo[8.6.1.01,12.03,8]heptadecane-17,2'-oxirane]-4-yl] pyridine-3-carboxylate |
SMILES (Canonical) | CCC(C)C(=O)OC1C2C(C(C(C1OC(=O)C3=CN=CC=C3)(C)C)CC(=O)OC)(C(=O)C4(C(C5(C(OC(=O)C(C5(C46CO6)O2)OC(=O)C)C7=COC=C7)C)OC(=O)C)O)C.CCC(C)C(=O)OC1C(C2C(C(C1(C)C)CC(=O)OC)(C(=O)C3(C(C4(C(OC(=O)C(C4(C35CO5)O2)OC(=O)C)C6=COC=C6)C)OC(=O)C)O)C)OC(=O)C7=CN=CC=C7 |
SMILES (Isomeric) | CCC(C)C(=O)OC1C2C(C(C(C1OC(=O)C3=CN=CC=C3)(C)C)CC(=O)OC)(C(=O)C4(C(C5(C(OC(=O)C(C5(C46CO6)O2)OC(=O)C)C7=COC=C7)C)OC(=O)C)O)C.CCC(C)C(=O)OC1C(C2C(C(C1(C)C)CC(=O)OC)(C(=O)C3(C(C4(C(OC(=O)C(C4(C35CO5)O2)OC(=O)C)C6=COC=C6)C)OC(=O)C)O)C)OC(=O)C7=CN=CC=C7 |
InChI | InChI=1S/2C42H49NO17/c1-10-20(2)32(47)59-29-27(57-33(48)23-12-11-14-43-17-23)30-38(7,25(37(29,5)6)16-26(46)52-9)35(50)41(51)36(56-22(4)45)39(8)28(24-13-15-53-18-24)58-34(49)31(55-21(3)44)42(39,60-30)40(41)19-54-40;1-10-20(2)32(47)57-27-29(59-33(48)23-12-11-14-43-17-23)37(5,6)25(16-26(46)52-9)38(7)30(27)60-42-31(55-21(3)44)34(49)58-28(24-13-15-53-18-24)39(42,8)36(56-22(4)45)41(51,35(38)50)40(42)19-54-40/h2*11-15,17-18,20,25,27-31,36,51H,10,16,19H2,1-9H3 |
InChI Key | CDZRVCDLZNCHLS-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C84H98N2O34 |
Molecular Weight | 1679.70 g/mol |
Exact Mass | 1678.6000982 g/mol |
Topological Polar Surface Area (TPSA) | 486.00 Ų |
XlogP | 0.00 |
There are no found synonyms. |
![2D Structure of [11,16-Diacetyloxy-13-(furan-3-yl)-10-hydroxy-7-(2-methoxy-2-oxoethyl)-6,6,8,12-tetramethyl-4-(2-methylbutanoyloxy)-9,15-dioxospiro[2,14-dioxatetracyclo[8.6.1.01,12.03,8]heptadecane-17,2'-oxirane]-5-yl] pyridine-3-carboxylate;[11,16-diacetyloxy-13-(furan-3-yl)-10-hydroxy-7-(2-methoxy-2-oxoethyl)-6,6,8,12-tetramethyl-5-(2-methylbutanoyloxy)-9,15-dioxospiro[2,14-dioxatetracyclo[8.6.1.01,12.03,8]heptadecane-17,2'-oxirane]-4-yl] pyridine-3-carboxylate 2D Structure of [11,16-Diacetyloxy-13-(furan-3-yl)-10-hydroxy-7-(2-methoxy-2-oxoethyl)-6,6,8,12-tetramethyl-4-(2-methylbutanoyloxy)-9,15-dioxospiro[2,14-dioxatetracyclo[8.6.1.01,12.03,8]heptadecane-17,2'-oxirane]-5-yl] pyridine-3-carboxylate;[11,16-diacetyloxy-13-(furan-3-yl)-10-hydroxy-7-(2-methoxy-2-oxoethyl)-6,6,8,12-tetramethyl-5-(2-methylbutanoyloxy)-9,15-dioxospiro[2,14-dioxatetracyclo[8.6.1.01,12.03,8]heptadecane-17,2'-oxirane]-4-yl] pyridine-3-carboxylate](https://plantaedb.com/storage/docs/compounds/2023/11/5707e330-8708-11ee-8ec9-0d4313bd79a4.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 99.57% | 85.14% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.60% | 96.09% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 97.78% | 97.79% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 97.40% | 94.45% |
CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 96.28% | 98.75% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.04% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 93.76% | 98.95% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 93.19% | 99.23% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 92.88% | 90.17% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.41% | 86.33% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 90.71% | 94.00% |
CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 89.96% | 89.34% |
CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 89.66% | 95.71% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 88.00% | 91.07% |
CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 86.84% | 92.88% |
CHEMBL3437 | Q16853 | Amine oxidase, copper containing | 86.71% | 94.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.66% | 89.00% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 86.50% | 92.62% |
CHEMBL2535 | P11166 | Glucose transporter | 85.77% | 98.75% |
CHEMBL202 | P00374 | Dihydrofolate reductase | 84.73% | 89.92% |
CHEMBL2094128 | P24941 | Cyclin-dependent kinase 2/cyclin A | 84.55% | 97.25% |
CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 84.51% | 95.71% |
CHEMBL5028 | O14672 | ADAM10 | 83.58% | 97.50% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.36% | 95.89% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 83.17% | 96.00% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 82.98% | 91.24% |
CHEMBL4208 | P20618 | Proteasome component C5 | 82.51% | 90.00% |
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 82.31% | 95.17% |
CHEMBL2716 | Q8WUI4 | Histone deacetylase 7 | 81.74% | 89.44% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 81.01% | 97.09% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Ekebergia capensis |
PubChem | 163196178 |
LOTUS | LTS0211322 |
wikiData | Q104955364 |