5,7-dihydroxy-8-[(2R)-2-methylbutanoyl]-4-phenylchromen-2-one
Internal ID | 2ff3cdd1-026e-404f-b431-abc22c22fc1b |
Taxonomy | Phenylpropanoids and polyketides > Neoflavonoids > Neoflavones |
IUPAC Name | 5,7-dihydroxy-8-[(2R)-2-methylbutanoyl]-4-phenylchromen-2-one |
SMILES (Canonical) | CCC(C)C(=O)C1=C(C=C(C2=C1OC(=O)C=C2C3=CC=CC=C3)O)O |
SMILES (Isomeric) | CC[C@@H](C)C(=O)C1=C(C=C(C2=C1OC(=O)C=C2C3=CC=CC=C3)O)O |
InChI | InChI=1S/C20H18O5/c1-3-11(2)19(24)18-15(22)10-14(21)17-13(9-16(23)25-20(17)18)12-7-5-4-6-8-12/h4-11,21-22H,3H2,1-2H3/t11-/m1/s1 |
InChI Key | IFHYIQSUBZXSBP-LLVKDONJSA-N |
Popularity | 0 references in papers |
Molecular Formula | C20H18O5 |
Molecular Weight | 338.40 g/mol |
Exact Mass | 338.11542367 g/mol |
Topological Polar Surface Area (TPSA) | 83.80 Ų |
XlogP | 4.00 |
There are no found synonyms. |
![2D Structure of 5,7-dihydroxy-8-[(2R)-2-methylbutanoyl]-4-phenylchromen-2-one 2D Structure of 5,7-dihydroxy-8-[(2R)-2-methylbutanoyl]-4-phenylchromen-2-one](https://plantaedb.com/storage/docs/compounds/2023/11/57-dihydroxy-8-2r-2-methylbutanoyl-4-phenylchromen-2-one.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 99.32% | 98.95% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.40% | 91.11% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.21% | 95.56% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.52% | 86.33% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 89.40% | 95.50% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.01% | 89.00% |
CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 86.71% | 100.00% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 86.57% | 99.23% |
CHEMBL3401 | O75469 | Pregnane X receptor | 85.31% | 94.73% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 85.09% | 96.09% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 84.67% | 99.15% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 82.76% | 99.17% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 81.82% | 96.95% |
CHEMBL5284 | Q96RR4 | CaM-kinase kinase beta | 81.18% | 89.23% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 80.94% | 90.17% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Euphorbia tithymaloides |
PubChem | 162866327 |
LOTUS | LTS0093625 |
wikiData | Q105112182 |