5,7-Dihydroxy-3-[(4-hydroxyphenyl)methylidene]-8-methoxychromen-4-one
| Internal ID | f4fb5bc1-6801-4e6f-8db9-8b42722e7033 |
| Taxonomy | Phenylpropanoids and polyketides > Homoisoflavonoids |
| IUPAC Name | 5,7-dihydroxy-3-[(4-hydroxyphenyl)methylidene]-8-methoxychromen-4-one |
| SMILES (Canonical) | COC1=C(C=C(C2=C1OCC(=CC3=CC=C(C=C3)O)C2=O)O)O |
| SMILES (Isomeric) | COC1=C(C=C(C2=C1OCC(=CC3=CC=C(C=C3)O)C2=O)O)O |
| InChI | InChI=1S/C17H14O6/c1-22-16-13(20)7-12(19)14-15(21)10(8-23-17(14)16)6-9-2-4-11(18)5-3-9/h2-7,18-20H,8H2,1H3 |
| InChI Key | XUSPHMFWFNGRPP-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C17H14O6 |
| Molecular Weight | 314.29 g/mol |
| Exact Mass | 314.07903816 g/mol |
| Topological Polar Surface Area (TPSA) | 96.20 Ų |
| XlogP | 2.80 |
| There are no found synonyms. |
![2D Structure of 5,7-Dihydroxy-3-[(4-hydroxyphenyl)methylidene]-8-methoxychromen-4-one](https://plantaedb.com/storage/docs/compounds/2023/11/57-dihydroxy-3-4-hydroxyphenylmethylidene-8-methoxychromen-4-one.jpg "2D Structure of 5,7-Dihydroxy-3-[(4-hydroxyphenyl)methylidene]-8-methoxychromen-4-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.73% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.68% | 95.56% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 96.15% | 94.45% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 90.48% | 89.00% |
| CHEMBL2581 | P07339 | Cathepsin D | 90.44% | 98.95% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.39% | 86.33% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 87.69% | 91.49% |
| CHEMBL3194 | P02766 | Transthyretin | 86.36% | 90.71% |
| CHEMBL242 | Q92731 | Estrogen receptor beta | 86.30% | 98.35% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 85.32% | 90.00% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 85.13% | 94.73% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 84.26% | 96.09% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 82.85% | 93.10% |
| CHEMBL1929 | P47989 | Xanthine dehydrogenase | 82.79% | 96.12% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 82.31% | 99.23% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 82.17% | 93.40% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 80.57% | 99.17% |
| CHEMBL2535 | P11166 | Glucose transporter | 80.12% | 98.75% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Eucomis comosa |
| Scilla luciliae |
| PubChem | 162885146 |
| LOTUS | LTS0264756 |
| wikiData | Q105342551 |