5,7-Dihydroxy-3-[(4-hydroxyphenyl)methylidene]-6-methylchromen-4-one
| Internal ID | e33028b3-9805-4a47-a3c1-df499bd74ba8 |
| Taxonomy | Phenylpropanoids and polyketides > Homoisoflavonoids |
| IUPAC Name | 5,7-dihydroxy-3-[(4-hydroxyphenyl)methylidene]-6-methylchromen-4-one |
| SMILES (Canonical) | CC1=C(C2=C(C=C1O)OCC(=CC3=CC=C(C=C3)O)C2=O)O |
| SMILES (Isomeric) | CC1=C(C2=C(C=C1O)OCC(=CC3=CC=C(C=C3)O)C2=O)O |
| InChI | InChI=1S/C17H14O5/c1-9-13(19)7-14-15(16(9)20)17(21)11(8-22-14)6-10-2-4-12(18)5-3-10/h2-7,18-20H,8H2,1H3 |
| InChI Key | QQNUVAQAOFSXSN-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C17H14O5 |
| Molecular Weight | 298.29 g/mol |
| Exact Mass | 298.08412354 g/mol |
| Topological Polar Surface Area (TPSA) | 87.00 Ų |
| XlogP | 3.20 |
| There are no found synonyms. |
![2D Structure of 5,7-Dihydroxy-3-[(4-hydroxyphenyl)methylidene]-6-methylchromen-4-one](https://plantaedb.com/storage/docs/compounds/2023/11/57-dihydroxy-3-4-hydroxyphenylmethylidene-6-methylchromen-4-one.jpg "2D Structure of 5,7-Dihydroxy-3-[(4-hydroxyphenyl)methylidene]-6-methylchromen-4-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 97.44% | 95.56% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.24% | 91.11% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 95.08% | 89.00% |
| CHEMBL2581 | P07339 | Cathepsin D | 93.68% | 98.95% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 91.69% | 91.49% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.69% | 94.45% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 88.63% | 100.00% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 88.53% | 94.73% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 87.57% | 93.40% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.03% | 86.33% |
| CHEMBL1929 | P47989 | Xanthine dehydrogenase | 86.41% | 96.12% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 86.12% | 99.23% |
| CHEMBL2039 | P27338 | Monoamine oxidase B | 85.98% | 92.51% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 83.85% | 93.10% |
| CHEMBL5966 | P55899 | IgG receptor FcRn large subunit p51 | 83.79% | 90.93% |
| CHEMBL3194 | P02766 | Transthyretin | 83.75% | 90.71% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 83.70% | 90.71% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 82.46% | 90.00% |
| CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] | 82.20% | 83.57% |
| CHEMBL242 | Q92731 | Estrogen receptor beta | 81.10% | 98.35% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Anemarrhena asphodeloides |
| PubChem | 75068791 |
| LOTUS | LTS0105667 |
| wikiData | Q105225953 |