5,7-Dihydroxy-3-[(2-hydroxy-4-methoxyphenyl)methyl]-6,8-dimethyl-2,3-dihydrochromen-4-one
Internal ID | 7154e389-649e-4bd2-af67-f8562030fe71 |
Taxonomy | Phenylpropanoids and polyketides > Homoisoflavonoids > Homoisoflavans > Homoisoflavanones |
IUPAC Name | 5,7-dihydroxy-3-[(2-hydroxy-4-methoxyphenyl)methyl]-6,8-dimethyl-2,3-dihydrochromen-4-one |
SMILES (Canonical) | CC1=C(C(=C2C(=C1O)C(=O)C(CO2)CC3=C(C=C(C=C3)OC)O)C)O |
SMILES (Isomeric) | CC1=C(C(=C2C(=C1O)C(=O)C(CO2)CC3=C(C=C(C=C3)OC)O)C)O |
InChI | InChI=1S/C19H20O6/c1-9-16(21)10(2)19-15(17(9)22)18(23)12(8-25-19)6-11-4-5-13(24-3)7-14(11)20/h4-5,7,12,20-22H,6,8H2,1-3H3 |
InChI Key | YVHOGEZRSOFSOD-UHFFFAOYSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C19H20O6 |
Molecular Weight | 344.40 g/mol |
Exact Mass | 344.12598835 g/mol |
Topological Polar Surface Area (TPSA) | 96.20 Ų |
XlogP | 3.60 |
There are no found synonyms. |
![2D Structure of 5,7-Dihydroxy-3-[(2-hydroxy-4-methoxyphenyl)methyl]-6,8-dimethyl-2,3-dihydrochromen-4-one 2D Structure of 5,7-Dihydroxy-3-[(2-hydroxy-4-methoxyphenyl)methyl]-6,8-dimethyl-2,3-dihydrochromen-4-one](https://plantaedb.com/storage/docs/compounds/2023/11/57-dihydroxy-3-2-hydroxy-4-methoxyphenylmethyl-68-dimethyl-23-dihydrochromen-4-one.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.28% | 91.11% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 95.66% | 99.15% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.44% | 95.56% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 94.46% | 94.00% |
CHEMBL2581 | P07339 | Cathepsin D | 93.75% | 98.95% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.24% | 97.09% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 92.19% | 92.62% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.76% | 86.33% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 89.22% | 96.09% |
CHEMBL4581 | P52732 | Kinesin-like protein 1 | 88.66% | 93.18% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 88.48% | 99.17% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 88.19% | 95.89% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 86.25% | 93.99% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 86.08% | 95.89% |
CHEMBL3401 | O75469 | Pregnane X receptor | 85.15% | 94.73% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.65% | 89.00% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 84.14% | 94.80% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 83.95% | 90.71% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 83.15% | 91.07% |
CHEMBL1929 | P47989 | Xanthine dehydrogenase | 81.93% | 96.12% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 81.72% | 99.23% |
CHEMBL4208 | P20618 | Proteasome component C5 | 81.60% | 90.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 81.19% | 94.45% |
CHEMBL2535 | P11166 | Glucose transporter | 81.06% | 98.75% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Polygonatum odoratum |
PubChem | 24996522 |
LOTUS | LTS0094630 |
wikiData | Q105365364 |