5,6,7,8,4'-Pentahydroxyflavone
| Internal ID | e17c1323-a0f7-4138-af0e-868be04993c3 |
| Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavones |
| IUPAC Name | 5,6,7,8-tetrahydroxy-2-(4-hydroxyphenyl)chromen-4-one |
| SMILES (Canonical) | C1=CC(=CC=C1C2=CC(=O)C3=C(C(=C(C(=C3O2)O)O)O)O)O |
| SMILES (Isomeric) | C1=CC(=CC=C1C2=CC(=O)C3=C(C(=C(C(=C3O2)O)O)O)O)O |
| InChI | InChI=1S/C15H10O7/c16-7-3-1-6(2-4-7)9-5-8(17)10-11(18)12(19)13(20)14(21)15(10)22-9/h1-5,16,18-21H |
| InChI Key | SPZXXUUDYMHBSG-UHFFFAOYSA-N |
| Popularity | 8 references in papers |
| Molecular Formula | C15H10O7 |
| Molecular Weight | 302.23 g/mol |
| Exact Mass | 302.04265265 g/mol |
| Topological Polar Surface Area (TPSA) | 127.00 Ų |
| XlogP | 2.00 |
| Atomic LogP (AlogP) | 1.99 |
| H-Bond Acceptor | 7 |
| H-Bond Donor | 5 |
| Rotatable Bonds | 1 |
| 5,6,7,8,4'-Pentahydroxyflavone |
| 577-26-4 |
| 4H-1-Benzopyran-4-one, 5,6,7,8-tetrahydroxy-2-(4-hydroxyphenyl)- |
| LMG443BS12 |
| CHEBI:79553 |
| NSC-76988 |
| DTXSID60206400 |
| 2-(4-Hydroxyphenyl)-5,6,7,8-tetrahydroxy-4H-1-benzopyran-4-one |
| 5,6,7,8-tetrahydroxy-2-(4-hydroxyphenyl)-4H-1-benzopyran-4-one |
| RefChem:1072167 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.9071 | 90.71% |
| Caco-2 | - | 0.5146 | 51.46% |
| Blood Brain Barrier | - | 0.7750 | 77.50% |
| Human oral bioavailability | - | 0.7571 | 75.71% |
| Subcellular localzation | Mitochondria | 0.5892 | 58.92% |
| OATP2B1 inhibitior | - | 0.5248 | 52.48% |
| OATP1B1 inhibitior | + | 0.8526 | 85.26% |
| OATP1B3 inhibitior | + | 0.9480 | 94.80% |
| MATE1 inhibitior | + | 0.6600 | 66.00% |
| OCT2 inhibitior | - | 0.9750 | 97.50% |
| BSEP inhibitior | - | 0.8192 | 81.92% |
| P-glycoprotein inhibitior | - | 0.9107 | 91.07% |
| P-glycoprotein substrate | - | 0.9230 | 92.30% |
| CYP3A4 substrate | - | 0.5494 | 54.94% |
| CYP2C9 substrate | - | 1.0000 | 100.00% |
| CYP2D6 substrate | - | 0.8553 | 85.53% |
| CYP3A4 inhibition | + | 0.6951 | 69.51% |
| CYP2C9 inhibition | - | 0.5823 | 58.23% |
| CYP2C19 inhibition | - | 0.9025 | 90.25% |
| CYP2D6 inhibition | - | 0.9287 | 92.87% |
| CYP1A2 inhibition | + | 0.9106 | 91.06% |
| CYP2C8 inhibition | + | 0.6459 | 64.59% |
| CYP inhibitory promiscuity | + | 0.5822 | 58.22% |
| UGT catelyzed | + | 0.7000 | 70.00% |
| Carcinogenicity (binary) | - | 1.0000 | 100.00% |
| Carcinogenicity (trinary) | Non-required | 0.6750 | 67.50% |
| Eye corrosion | - | 0.9905 | 99.05% |
| Eye irritation | + | 0.9208 | 92.08% |
| Skin irritation | + | 0.5835 | 58.35% |
| Skin corrosion | - | 0.9397 | 93.97% |
| Ames mutagenesis | + | 0.5100 | 51.00% |
| Human Ether-a-go-go-Related Gene inhibition | - | 0.7817 | 78.17% |
| Micronuclear | + | 0.9300 | 93.00% |
| Hepatotoxicity | - | 0.5375 | 53.75% |
| skin sensitisation | - | 0.7447 | 74.47% |
| Respiratory toxicity | - | 0.5778 | 57.78% |
| Reproductive toxicity | + | 0.7667 | 76.67% |
| Mitochondrial toxicity | + | 0.5875 | 58.75% |
| Nephrotoxicity | - | 0.7101 | 71.01% |
| Acute Oral Toxicity (c) | II | 0.7348 | 73.48% |
| Estrogen receptor binding | + | 0.8206 | 82.06% |
| Androgen receptor binding | + | 0.9130 | 91.30% |
| Thyroid receptor binding | + | 0.5139 | 51.39% |
| Glucocorticoid receptor binding | + | 0.9085 | 90.85% |
| Aromatase binding | + | 0.7977 | 79.77% |
| PPAR gamma | + | 0.9127 | 91.27% |
| Honey bee toxicity | - | 0.7954 | 79.54% |
| Biodegradation | - | 0.9000 | 90.00% |
| Crustacea aquatic toxicity | - | 0.5100 | 51.00% |
| Fish aquatic toxicity | + | 0.9124 | 91.24% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| CHEMBL2331053 | Q16875 | 6-phosphofructo-2-kinase/fructose-2,6-bisphosphatase 3 |
2970 nM |
IC50 |
PMID: 24398380
|
| CHEMBL5979 | P05186 | Alkaline phosphatase, tissue-nonspecific isozyme |
43400 nM |
EC50 |
via CMAUP
|
| CHEMBL1293236 | P46063 | ATP-dependent DNA helicase Q1 |
12589.3 nM |
Potency |
via CMAUP
|
| CHEMBL1293237 | P54132 | Bloom syndrome protein |
10000 nM |
Potency |
via CMAUP
|
| CHEMBL2392 | P06746 | DNA polymerase beta |
2238.7 nM |
Potency |
via CMAUP
|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase |
501.2 nM 501.2 nM |
Potency Potency |
via CMAUP
via Super-PRED |
| CHEMBL2284 | P04406 | Glyceraldehyde-3-phosphate dehydrogenase liver |
8191.1 nM |
Potency |
via CMAUP
|
| CHEMBL1293299 | Q03164 | Histone-lysine N-methyltransferase MLL |
39810.7 nM |
Potency |
via CMAUP
|
| CHEMBL4361 | Q07820 | Induced myeloid leukemia cell differentiation protein Mcl-1 |
18751 nM |
IC50 |
via CMAUP
|
| CHEMBL1287622 | Q9Y468 | Lethal(3)malignant brain tumor-like protein 1 |
3162.3 nM |
Potency |
via CMAUP
|
| CHEMBL1293226 | B2RXH2 | Lysine-specific demethylase 4D-like |
12589.3 nM |
Potency |
via CMAUP
|
| CHEMBL2608 | P10253 | Lysosomal alpha-glucosidase |
17782.8 nM |
Potency |
via CMAUP
|
| CHEMBL1293224 | P10636 | Microtubule-associated protein tau |
14125.4 nM 14125.4 nM |
Potency Potency |
via CMAUP
via CMAUP |
| CHEMBL1075189 | P14618 | Pyruvate kinase isozymes M1/M2 |
39810.7 nM 39810.7 nM |
Potency Potency |
via CMAUP
via CMAUP |
| CHEMBL1075138 | Q9NUW8 | Tyrosyl-DNA phosphodiesterase 1 |
4466.8 nM |
Potency |
via CMAUP
|
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 96.21% | 98.95% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 93.54% | 94.00% |
| CHEMBL242 | Q92731 | Estrogen receptor beta | 92.65% | 98.35% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 90.52% | 89.00% |
| CHEMBL2553 | Q15418 | Ribosomal protein S6 kinase alpha 1 | 89.95% | 85.11% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 89.61% | 99.15% |
| CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] | 88.86% | 83.57% |
| CHEMBL3194 | P02766 | Transthyretin | 88.04% | 90.71% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 86.21% | 91.71% |
| CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 85.57% | 95.64% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.00% | 86.33% |
| CHEMBL5284 | Q96RR4 | CaM-kinase kinase beta | 84.26% | 89.23% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 84.04% | 94.73% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 83.44% | 90.71% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 83.19% | 95.56% |
| CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 81.64% | 97.28% |
| CHEMBL301 | P24941 | Cyclin-dependent kinase 2 | 81.47% | 91.23% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 80.68% | 99.17% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 80.48% | 85.14% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 80.16% | 94.45% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Glycyrrhiza |
| Marrubium cylleneum |
| PubChem | 96506 |
| NPASS | NPC216318 |
| ChEMBL | CHEMBL234338 |
| LOTUS | LTS0168638 |
| wikiData | Q27148666 |