5,6,7,8,2',3',5'-Heptahydroxy-4'-methoxyflavanone
Internal ID | 7bc9c73c-dab8-4357-aa5e-4b467154a9a8 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > O-methylated flavonoids > 4-O-methylated flavonoids |
IUPAC Name | 5,6,7,8-tetrahydroxy-2-(2,3,5-trihydroxy-4-methoxyphenyl)-2,3-dihydrochromen-4-one |
SMILES (Canonical) | COC1=C(C=C(C(=C1O)O)C2CC(=O)C3=C(C(=C(C(=C3O2)O)O)O)O)O |
SMILES (Isomeric) | COC1=C(C=C(C(=C1O)O)C2CC(=O)C3=C(C(=C(C(=C3O2)O)O)O)O)O |
InChI | InChI=1S/C16H14O10/c1-25-15-6(18)2-4(9(19)13(15)23)7-3-5(17)8-10(20)11(21)12(22)14(24)16(8)26-7/h2,7,18-24H,3H2,1H3 |
InChI Key | OEMGXTOORNZOFO-UHFFFAOYSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C16H14O10 |
Molecular Weight | 366.28 g/mol |
Exact Mass | 366.05869664 g/mol |
Topological Polar Surface Area (TPSA) | 177.00 Ų |
XlogP | 0.90 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.30% | 91.11% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 93.63% | 85.14% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.03% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 88.07% | 98.95% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.47% | 95.56% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 85.13% | 99.15% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 84.69% | 94.00% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 84.09% | 99.23% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 83.96% | 86.33% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 82.76% | 99.17% |
CHEMBL2094127 | P06493 | Cyclin-dependent kinase 1/cyclin B | 81.88% | 96.00% |
CHEMBL1163101 | O75460 | Serine/threonine-protein kinase/endoribonuclease IRE1 | 81.25% | 98.11% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.05% | 95.89% |
CHEMBL4208 | P20618 | Proteasome component C5 | 80.87% | 90.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 80.36% | 89.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Punica granatum |
PubChem | 129882348 |
LOTUS | LTS0066608 |
wikiData | Q105190372 |