[2-(3,4-Dihydroxyphenyl)-5-hydroxy-4-oxo-3-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxychromen-7-yl] 3,4,5,6-tetrahydroxyoxane-2-carboxylate
Internal ID | ab5e9d18-f3d1-4ffc-86b2-ae1b5522024f |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides > Flavonoid-3-O-glycosides |
IUPAC Name | [2-(3,4-dihydroxyphenyl)-5-hydroxy-4-oxo-3-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxychromen-7-yl] 3,4,5,6-tetrahydroxyoxane-2-carboxylate |
SMILES (Canonical) | CC1C(C(C(C(O1)OC2=C(OC3=CC(=CC(=C3C2=O)O)OC(=O)C4C(C(C(C(O4)O)O)O)O)C5=CC(=C(C=C5)O)O)O)O)O |
SMILES (Isomeric) | CC1C(C(C(C(O1)OC2=C(OC3=CC(=CC(=C3C2=O)O)OC(=O)C4C(C(C(C(O4)O)O)O)O)C5=CC(=C(C=C5)O)O)O)O)O |
InChI | InChI=1S/C27H28O17/c1-7-15(31)17(33)21(37)27(40-7)44-23-16(32)14-12(30)5-9(41-26(39)24-19(35)18(34)20(36)25(38)43-24)6-13(14)42-22(23)8-2-3-10(28)11(29)4-8/h2-7,15,17-21,24-25,27-31,33-38H,1H3 |
InChI Key | REQXKEDYIDVWGQ-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C27H28O17 |
Molecular Weight | 624.50 g/mol |
Exact Mass | 624.13264942 g/mol |
Topological Polar Surface Area (TPSA) | 283.00 Ų |
XlogP | -1.20 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.29% | 91.11% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 98.39% | 91.49% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 98.11% | 89.00% |
CHEMBL2581 | P07339 | Cathepsin D | 95.76% | 98.95% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.82% | 86.33% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 93.04% | 94.00% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 92.70% | 99.15% |
CHEMBL3401 | O75469 | Pregnane X receptor | 92.37% | 94.73% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.27% | 99.17% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.40% | 95.56% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 87.50% | 95.78% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 87.21% | 99.23% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 86.97% | 85.14% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 86.61% | 90.71% |
CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 84.81% | 93.65% |
CHEMBL2243 | O00519 | Anandamide amidohydrolase | 84.51% | 97.53% |
CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 84.40% | 95.64% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 82.58% | 97.36% |
CHEMBL3194 | P02766 | Transthyretin | 81.35% | 90.71% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 81.34% | 96.09% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 80.18% | 86.92% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Carthamus tinctorius |
PubChem | 162901875 |
LOTUS | LTS0219658 |
wikiData | Q105235031 |