5,6-Dihydrobicolorine
| Internal ID | 17f035e1-71d3-491d-9ada-4f362a7a9039 |
| Taxonomy | Organoheterocyclic compounds > Quinolines and derivatives > Benzoquinolines > Phenanthridines and derivatives |
| IUPAC Name | 5-methyl-6H-[1,3]dioxolo[4,5-j]phenanthridine |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C15H13NO2/c1-16-8-10-6-14-15(18-9-17-14)7-12(10)11-4-2-3-5-13(11)16/h2-7H,8-9H2,1H3 |
| InChI Key | WAZIYEFJZKKXBR-UHFFFAOYSA-N |
| Popularity | 8 references in papers |
| Molecular Formula | C15H13NO2 |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.094628657 g/mol |
| Topological Polar Surface Area (TPSA) | 21.70 Ų |
| XlogP | 3.10 |
| NSC654242 |
| 5-Methyl-5,6-dihydro[1,3]dioxolo[4,5-j]phenanthridine |
| 5-methyl-6H-[1,3]dioxolo[4,5-j]phenanthridine |
| CHEMBL2005884 |
| NSC-654242 |
| NCI60_018834 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 96.62% | 98.95% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.62% | 86.33% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 91.33% | 96.77% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.07% | 95.56% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 89.88% | 96.09% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 89.20% | 90.00% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 88.37% | 93.65% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 87.65% | 93.40% |
| CHEMBL5805 | Q9NR97 | Toll-like receptor 8 | 85.82% | 96.25% |
| CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 85.69% | 94.80% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 83.72% | 91.11% |
| CHEMBL6007 | O75762 | Transient receptor potential cation channel subfamily A member 1 | 82.08% | 92.17% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 80.29% | 89.00% |
| CHEMBL264 | Q9Y5N1 | Histamine H3 receptor | 80.25% | 91.43% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Hymenocallis littoralis |
| Lycoris radiata |
| Narcissus bicolor |
| Narcissus tazetta |
| Zephyranthes candida |
| PubChem | 375118 |
| LOTUS | LTS0207172 |
| wikiData | Q105300546 |