2-[2-[3',16-Dihydroxy-7,9,13-trimethyl-5'-methylidene-4'-(3,4,5-trihydroxyoxan-2-yl)oxyspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-oxane]-14-yl]oxy-5-hydroxy-6-methyl-3-(3,4,5-trihydroxyoxan-2-yl)oxyoxan-4-yl]oxy-6-methyloxane-3,4,5-triol
| Internal ID | 3cf7b46e-1cb5-4149-8949-af56e4e6a686 |
| Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides > Steroidal saponins |
| IUPAC Name | 2-[2-[3',16-dihydroxy-7,9,13-trimethyl-5'-methylidene-4'-(3,4,5-trihydroxyoxan-2-yl)oxyspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-oxane]-14-yl]oxy-5-hydroxy-6-methyl-3-(3,4,5-trihydroxyoxan-2-yl)oxyoxan-4-yl]oxy-6-methyloxane-3,4,5-triol |
| SMILES (Canonical) | CC1C2C(CC3C2(CCC4C3CC=C5C4(C(CC(C5)O)OC6C(C(C(C(O6)C)O)OC7C(C(C(C(O7)C)O)O)O)OC8C(C(C(CO8)O)O)O)C)C)OC19C(C(C(=C)CO9)OC1C(C(C(CO1)O)O)O)O |
| SMILES (Isomeric) | CC1C2C(CC3C2(CCC4C3CC=C5C4(C(CC(C5)O)OC6C(C(C(C(O6)C)O)OC7C(C(C(C(O7)C)O)O)O)OC8C(C(C(CO8)O)O)O)C)C)OC19C(C(C(=C)CO9)OC1C(C(C(CO1)O)O)O)O |
| InChI | InChI=1S/C49H76O22/c1-17-14-64-49(42(61)39(17)68-43-36(58)33(55)26(51)15-62-43)18(2)30-28(71-49)13-25-23-8-7-21-11-22(50)12-29(48(21,6)24(23)9-10-47(25,30)5)67-46-41(70-44-37(59)34(56)27(52)16-63-44)40(32(54)20(4)66-46)69-45-38(60)35(57)31(53)19(3)65-45/h7,18-20,22-46,50-61H,1,8-16H2,2-6H3 |
| InChI Key | WBBFDXFFYOWQNF-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C49H76O22 |
| Molecular Weight | 1017.10 g/mol |
| Exact Mass | 1016.48282405 g/mol |
| Topological Polar Surface Area (TPSA) | 335.00 Ų |
| XlogP | -3.30 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.51% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.66% | 96.09% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 95.88% | 95.93% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.02% | 86.33% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 93.65% | 100.00% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 90.71% | 95.89% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 90.26% | 89.00% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.64% | 97.09% |
| CHEMBL1871 | P10275 | Androgen Receptor | 86.20% | 96.43% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 85.31% | 94.45% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 85.17% | 90.17% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 84.83% | 92.88% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 84.32% | 94.00% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.29% | 95.89% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 84.27% | 97.25% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 83.22% | 92.94% |
| CHEMBL2243 | O00519 | Anandamide amidohydrolase | 81.14% | 97.53% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 80.58% | 94.73% |
| CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 80.04% | 97.28% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Dracaena fragrans |
| PubChem | 56673056 |
| LOTUS | LTS0097907 |
| wikiData | Q105300609 |