[6-[2-(3,4-Dihydroxyphenyl)-5,7-dihydroxy-4-oxochromen-3-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methyl 3-(3,4-dihydroxyphenyl)prop-2-enoate
Internal ID | 278b0ce4-0665-44d5-b056-99dc4c811bba |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid 3-O-p-coumaroyl glycosides |
IUPAC Name | [6-[2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-4-oxochromen-3-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methyl 3-(3,4-dihydroxyphenyl)prop-2-enoate |
SMILES (Canonical) | C1=CC(=C(C=C1C=CC(=O)OCC2C(C(C(C(O2)OC3=C(OC4=CC(=CC(=C4C3=O)O)O)C5=CC(=C(C=C5)O)O)O)O)O)O)O |
SMILES (Isomeric) | C1=CC(=C(C=C1C=CC(=O)OCC2C(C(C(C(O2)OC3=C(OC4=CC(=CC(=C4C3=O)O)O)C5=CC(=C(C=C5)O)O)O)O)O)O)O |
InChI | InChI=1S/C30H26O15/c31-14-9-19(36)23-20(10-14)43-28(13-3-5-16(33)18(35)8-13)29(25(23)39)45-30-27(41)26(40)24(38)21(44-30)11-42-22(37)6-2-12-1-4-15(32)17(34)7-12/h1-10,21,24,26-27,30-36,38,40-41H,11H2 |
InChI Key | IHBVMUCQCZEAPW-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C30H26O15 |
Molecular Weight | 626.50 g/mol |
Exact Mass | 626.12717012 g/mol |
Topological Polar Surface Area (TPSA) | 253.00 Ų |
XlogP | 1.80 |
There are no found synonyms. |
![2D Structure of [6-[2-(3,4-Dihydroxyphenyl)-5,7-dihydroxy-4-oxochromen-3-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methyl 3-(3,4-dihydroxyphenyl)prop-2-enoate 2D Structure of [6-[2-(3,4-Dihydroxyphenyl)-5,7-dihydroxy-4-oxochromen-3-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methyl 3-(3,4-dihydroxyphenyl)prop-2-enoate](https://plantaedb.com/storage/docs/compounds/2023/11/55546670-8634-11ee-ae6c-914d8433cdb3.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL1900 | P15121 | Aldose reductase |
13.4 nM |
IC50 |
via Super-PRED
|
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.71% | 91.11% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 99.36% | 91.49% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 98.69% | 89.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 97.33% | 86.33% |
CHEMBL3194 | P02766 | Transthyretin | 96.13% | 90.71% |
CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 95.28% | 95.64% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 92.33% | 99.17% |
CHEMBL2581 | P07339 | Cathepsin D | 92.15% | 98.95% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 90.50% | 96.00% |
CHEMBL3401 | O75469 | Pregnane X receptor | 89.83% | 94.73% |
CHEMBL2085 | P14174 | Macrophage migration inhibitory factor | 89.56% | 80.78% |
CHEMBL1929 | P47989 | Xanthine dehydrogenase | 89.39% | 96.12% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 88.60% | 99.15% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.70% | 94.45% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.68% | 95.56% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.38% | 97.09% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 86.09% | 96.09% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 84.82% | 95.78% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 84.47% | 95.50% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 82.75% | 90.71% |
CHEMBL2179 | P04062 | Beta-glucocerebrosidase | 81.54% | 85.31% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Hydrocotyle sibthorpioides |
Laennecia filaginoides |
Monochaetum multiflorum |
Spiraea cantoniensis |
PubChem | 74347585 |
LOTUS | LTS0128755 |
wikiData | Q104665451 |