5,5'-Di-2-propenyl-3-methoxy-[1,1'-biphenyl]-2,2'-diol
| Internal ID | 55aa05cf-8015-4d9e-bbf7-0a0f8be7ec25 |
| Taxonomy | Benzenoids > Benzene and substituted derivatives > Biphenyls and derivatives |
| IUPAC Name | 2-(2-hydroxy-5-prop-2-enylphenyl)-6-methoxy-4-prop-2-enylphenol |
| SMILES (Canonical) | COC1=CC(=CC(=C1O)C2=C(C=CC(=C2)CC=C)O)CC=C |
| SMILES (Isomeric) | COC1=CC(=CC(=C1O)C2=C(C=CC(=C2)CC=C)O)CC=C |
| InChI | InChI=1S/C19H20O3/c1-4-6-13-8-9-17(20)15(10-13)16-11-14(7-5-2)12-18(22-3)19(16)21/h4-5,8-12,20-21H,1-2,6-7H2,3H3 |
| InChI Key | YJYOUDXYGAHCKS-UHFFFAOYSA-N |
| Popularity | 3 references in papers |
| Molecular Formula | C19H20O3 |
| Molecular Weight | 296.40 g/mol |
| Exact Mass | 296.14124450 g/mol |
| Topological Polar Surface Area (TPSA) | 49.70 Ų |
| XlogP | 5.00 |
| SCHEMBL18838050 |
| 5,5'-di-2-propenyl-3-methoxy-[1,1'-biphenyl]-2,2'-diol |
![2D Structure of 5,5'-Di-2-propenyl-3-methoxy-[1,1'-biphenyl]-2,2'-diol](https://plantaedb.com/storage/docs/compounds/2023/11/55-di-2-propenyl-3-methoxy-11-biphenyl-22-diol.jpg "2D Structure of 5,5'-Di-2-propenyl-3-methoxy-[1,1'-biphenyl]-2,2'-diol")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.06% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.72% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 94.94% | 98.95% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 93.69% | 90.24% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 93.28% | 95.17% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 92.44% | 99.17% |
| CHEMBL1163101 | O75460 | Serine/threonine-protein kinase/endoribonuclease IRE1 | 90.81% | 98.11% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.04% | 86.33% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 87.24% | 90.00% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 86.48% | 91.49% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.89% | 95.89% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 85.73% | 90.20% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.19% | 95.56% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 84.46% | 95.50% |
| CHEMBL3194 | P02766 | Transthyretin | 82.66% | 90.71% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 81.55% | 89.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Illicium dunnianum |
| Magnolia chevalieri |
| Magnolia henryi |
| PubChem | 14282780 |
| LOTUS | LTS0273524 |
| wikiData | Q105349551 |