5-Hydroxy-2-(4-hydroxy-3-methoxyphenyl)-7-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3-[3,4,5-trihydroxy-6-[(3,4,5-trihydroxy-6-methyloxan-2-yl)oxymethyl]oxan-2-yl]oxychromen-4-one
Internal ID | 45f2251d-4c02-4fba-9163-d3454bfdd14c |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides > Flavonoid-7-O-glycosides |
IUPAC Name | 5-hydroxy-2-(4-hydroxy-3-methoxyphenyl)-7-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3-[3,4,5-trihydroxy-6-[(3,4,5-trihydroxy-6-methyloxan-2-yl)oxymethyl]oxan-2-yl]oxychromen-4-one |
SMILES (Canonical) | CC1C(C(C(C(O1)OCC2C(C(C(C(O2)OC3=C(OC4=CC(=CC(=C4C3=O)O)OC5C(C(C(C(O5)CO)O)O)O)C6=CC(=C(C=C6)O)OC)O)O)O)O)O)O |
SMILES (Isomeric) | CC1C(C(C(C(O1)OCC2C(C(C(C(O2)OC3=C(OC4=CC(=CC(=C4C3=O)O)OC5C(C(C(C(O5)CO)O)O)O)C6=CC(=C(C=C6)O)OC)O)O)O)O)O)O |
InChI | InChI=1S/C34H42O21/c1-10-20(38)24(42)27(45)32(50-10)49-9-18-22(40)26(44)29(47)34(54-18)55-31-23(41)19-14(37)6-12(51-33-28(46)25(43)21(39)17(8-35)53-33)7-16(19)52-30(31)11-3-4-13(36)15(5-11)48-2/h3-7,10,17-18,20-22,24-29,32-40,42-47H,8-9H2,1-2H3 |
InChI Key | VLDJCNQOIAEWHD-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C34H42O21 |
Molecular Weight | 786.70 g/mol |
Exact Mass | 786.22185834 g/mol |
Topological Polar Surface Area (TPSA) | 334.00 Ų |
XlogP | -2.80 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.41% | 91.11% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 97.55% | 94.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 96.84% | 89.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 96.20% | 86.33% |
CHEMBL2581 | P07339 | Cathepsin D | 95.46% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.31% | 96.09% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 94.27% | 85.14% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 94.02% | 99.15% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 92.14% | 91.49% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 91.82% | 99.17% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 91.02% | 86.92% |
CHEMBL3401 | O75469 | Pregnane X receptor | 89.34% | 94.73% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.90% | 95.56% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 88.08% | 97.36% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.22% | 97.09% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 86.61% | 96.00% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 85.19% | 95.78% |
CHEMBL3194 | P02766 | Transthyretin | 82.66% | 90.71% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 80.75% | 95.89% |
CHEMBL1907 | P15144 | Aminopeptidase N | 80.39% | 93.31% |
CHEMBL4208 | P20618 | Proteasome component C5 | 80.34% | 90.00% |
CHEMBL220 | P22303 | Acetylcholinesterase | 80.12% | 94.45% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Coleogyne ramosissima |
PubChem | 53435854 |
LOTUS | LTS0251420 |
wikiData | Q105288303 |