[2-[6-(Acetyloxymethyl)-4-[6-(acetyloxymethyl)-3,4,5-trihydroxyoxan-2-yl]oxy-5-[3-(4-hydroxyphenyl)prop-2-enoyloxy]-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-4-hydroxy-2-[3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyloxymethyl]-5-(hydroxymethyl)oxolan-3-yl] benzoate
Internal ID | 05550e9f-be63-40cc-8f69-a5ce252f72cb |
Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbohydrates and carbohydrate conjugates > Oligosaccharides |
IUPAC Name | [2-[6-(acetyloxymethyl)-4-[6-(acetyloxymethyl)-3,4,5-trihydroxyoxan-2-yl]oxy-5-[3-(4-hydroxyphenyl)prop-2-enoyloxy]-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-4-hydroxy-2-[3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyloxymethyl]-5-(hydroxymethyl)oxolan-3-yl] benzoate |
SMILES (Canonical) | CC(=O)OCC1C(C(C(C(O1)OC2C(C(OC(C2OC3C(C(C(C(O3)CO)O)O)O)OC4(C(C(C(O4)CO)O)OC(=O)C5=CC=CC=C5)COC(=O)C=CC6=CC(=C(C=C6)O)OC)COC(=O)C)OC(=O)C=CC7=CC=C(C=C7)O)O)O)O |
SMILES (Isomeric) | CC(=O)OCC1C(C(C(C(O1)OC2C(C(OC(C2OC3C(C(C(C(O3)CO)O)O)O)OC4(C(C(C(O4)CO)O)OC(=O)C5=CC=CC=C5)COC(=O)C=CC6=CC(=C(C=C6)O)OC)COC(=O)C)OC(=O)C=CC7=CC=C(C=C7)O)O)O)O |
InChI | InChI=1S/C54H64O29/c1-25(57)72-22-35-40(64)43(67)45(69)52(76-35)79-47-46(78-38(62)18-12-27-9-14-30(59)15-10-27)36(23-73-26(2)58)77-53(48(47)80-51-44(68)42(66)39(63)33(20-55)75-51)83-54(24-74-37(61)17-13-28-11-16-31(60)32(19-28)71-3)49(41(65)34(21-56)82-54)81-50(70)29-7-5-4-6-8-29/h4-19,33-36,39-49,51-53,55-56,59-60,63-69H,20-24H2,1-3H3 |
InChI Key | CAAOZKYDLNHIQO-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C54H64O29 |
Molecular Weight | 1177.10 g/mol |
Exact Mass | 1176.35332600 g/mol |
Topological Polar Surface Area (TPSA) | 428.00 Ų |
XlogP | -0.80 |
There are no found synonyms. |
![2D Structure of [2-[6-(Acetyloxymethyl)-4-[6-(acetyloxymethyl)-3,4,5-trihydroxyoxan-2-yl]oxy-5-[3-(4-hydroxyphenyl)prop-2-enoyloxy]-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-4-hydroxy-2-[3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyloxymethyl]-5-(hydroxymethyl)oxolan-3-yl] benzoate 2D Structure of [2-[6-(Acetyloxymethyl)-4-[6-(acetyloxymethyl)-3,4,5-trihydroxyoxan-2-yl]oxy-5-[3-(4-hydroxyphenyl)prop-2-enoyloxy]-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-4-hydroxy-2-[3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyloxymethyl]-5-(hydroxymethyl)oxolan-3-yl] benzoate](https://plantaedb.com/storage/docs/compounds/2023/11/544c0640-8724-11ee-8d5a-43a49bda596d.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.38% | 91.11% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 99.23% | 86.33% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 97.47% | 96.00% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 97.25% | 85.14% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.21% | 96.09% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 96.64% | 91.49% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 93.15% | 99.17% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 92.80% | 89.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.89% | 95.56% |
CHEMBL3194 | P02766 | Transthyretin | 90.53% | 90.71% |
CHEMBL2716 | Q8WUI4 | Histone deacetylase 7 | 90.40% | 89.44% |
CHEMBL2581 | P07339 | Cathepsin D | 89.20% | 98.95% |
CHEMBL4208 | P20618 | Proteasome component C5 | 88.13% | 90.00% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 88.02% | 91.19% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 87.96% | 95.50% |
CHEMBL3401 | O75469 | Pregnane X receptor | 87.70% | 94.73% |
CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 86.96% | 83.00% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 85.02% | 97.14% |
CHEMBL2563 | Q9UQL6 | Histone deacetylase 5 | 83.15% | 89.67% |
CHEMBL5028 | O14672 | ADAM10 | 82.89% | 97.50% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 82.71% | 92.50% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 81.43% | 95.83% |
CHEMBL2535 | P11166 | Glucose transporter | 81.36% | 98.75% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 80.82% | 94.62% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 80.56% | 99.23% |
CHEMBL4630 | O14757 | Serine/threonine-protein kinase Chk1 | 80.56% | 97.03% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Polygala reinii |
Polygala wattersii |
PubChem | 78407233 |
LOTUS | LTS0172538 |
wikiData | Q104950820 |