(3S,5R,8S,10S,12S)-5,10,15-trimethyl-4,9,13-trioxatetracyclo[10.3.0.03,5.08,10]pentadec-1(15)-en-14-one
| Internal ID | 38640425-97f7-42cf-827b-e3fe8f106c74 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene lactones |
| IUPAC Name | (3S,5R,8S,10S,12S)-5,10,15-trimethyl-4,9,13-trioxatetracyclo[10.3.0.03,5.08,10]pentadec-1(15)-en-14-one |
| SMILES (Canonical) | CC1=C2CC3C(O3)(CCC4C(O4)(CC2OC1=O)C)C |
| SMILES (Isomeric) | CC1=C2C[C@H]3[C@](O3)(CC[C@H]4[C@@](O4)(C[C@@H]2OC1=O)C)C |
| InChI | InChI=1S/C15H20O4/c1-8-9-6-12-14(2,19-12)5-4-11-15(3,18-11)7-10(9)17-13(8)16/h10-12H,4-7H2,1-3H3/t10-,11-,12-,14+,15-/m0/s1 |
| InChI Key | CWAJEURPJYKGRL-JVSQWTDWSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C15H20O4 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.13615911 g/mol |
| Topological Polar Surface Area (TPSA) | 51.40 Ų |
| XlogP | 1.20 |
| There are no found synonyms. |
![2D Structure of (3S,5R,8S,10S,12S)-5,10,15-trimethyl-4,9,13-trioxatetracyclo[10.3.0.03,5.08,10]pentadec-1(15)-en-14-one](https://plantaedb.com/storage/docs/compounds/2023/11/53a188a0-8545-11ee-8021-d71352eda563.jpg "2D Structure of (3S,5R,8S,10S,12S)-5,10,15-trimethyl-4,9,13-trioxatetracyclo[10.3.0.03,5.08,10]pentadec-1(15)-en-14-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.17% | 95.56% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 88.64% | 85.14% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 88.40% | 97.14% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 85.72% | 97.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 84.75% | 98.95% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.03% | 86.33% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 83.29% | 97.25% |
| CHEMBL4803 | P29474 | Nitric-oxide synthase, endothelial | 82.69% | 86.00% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.19% | 95.89% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 81.69% | 96.61% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 81.35% | 82.69% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 81.27% | 100.00% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 80.71% | 96.09% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 80.27% | 93.40% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Smyrnium olusatrum |
| PubChem | 26328919 |
| LOTUS | LTS0078614 |
| wikiData | Q104971117 |