5,3'-Dihydroxy-6,7,4',5'-tetramethoxyflavanone
Internal ID | bac50330-c301-449b-9943-f6996ea449ff |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > O-methylated flavonoids > 7-O-methylated flavonoids |
IUPAC Name | 5-hydroxy-2-(3-hydroxy-4,5-dimethoxyphenyl)-6,7-dimethoxy-2,3-dihydrochromen-4-one |
SMILES (Canonical) | COC1=CC(=CC(=C1OC)O)C2CC(=O)C3=C(C(=C(C=C3O2)OC)OC)O |
SMILES (Isomeric) | COC1=CC(=CC(=C1OC)O)C2CC(=O)C3=C(C(=C(C=C3O2)OC)OC)O |
InChI | InChI=1S/C19H20O8/c1-23-14-6-9(5-11(21)18(14)25-3)12-7-10(20)16-13(27-12)8-15(24-2)19(26-4)17(16)22/h5-6,8,12,21-22H,7H2,1-4H3 |
InChI Key | ABIJRPKPVBZTCW-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C19H20O8 |
Molecular Weight | 376.40 g/mol |
Exact Mass | 376.11581759 g/mol |
Topological Polar Surface Area (TPSA) | 104.00 Ų |
XlogP | 2.60 |
CHEBI:193386 |
LMPK12140638 |
5-hydroxy-2-(3-hydroxy-4,5-dimethoxyphenyl)-6,7-dimethoxy-2,3-dihydrochromen-4-one |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.96% | 91.11% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 98.43% | 85.14% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.72% | 96.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.17% | 94.45% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 91.36% | 94.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 90.96% | 89.00% |
CHEMBL215 | P09917 | Arachidonate 5-lipoxygenase | 90.91% | 92.68% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.01% | 95.56% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 86.91% | 99.23% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.13% | 86.33% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 84.36% | 99.17% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 83.88% | 97.09% |
CHEMBL4247 | Q9UM73 | ALK tyrosine kinase receptor | 82.03% | 96.86% |
CHEMBL4208 | P20618 | Proteasome component C5 | 81.89% | 90.00% |
CHEMBL2535 | P11166 | Glucose transporter | 81.56% | 98.75% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 81.50% | 90.71% |
CHEMBL2581 | P07339 | Cathepsin D | 81.41% | 98.95% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 81.26% | 99.15% |
CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 80.62% | 82.38% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.39% | 95.89% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 80.02% | 92.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Greigia sphacelata |
PubChem | 10833336 |
LOTUS | LTS0220924 |
wikiData | Q104908628 |