1,10,11,12-Tetrahydroxy-1,2,6a,6b,9,9,12a-heptamethyl-2,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylic acid
Internal ID | d6861366-7f98-431f-9128-66f5b1e2aec5 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
IUPAC Name | 1,10,11,12-tetrahydroxy-1,2,6a,6b,9,9,12a-heptamethyl-2,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylic acid |
SMILES (Canonical) | CC1CCC2(CCC3(C(=CCC4C3(CCC5C4(C(C(C(C5(C)C)O)O)O)C)C)C2C1(C)O)C)C(=O)O |
SMILES (Isomeric) | CC1CCC2(CCC3(C(=CCC4C3(CCC5C4(C(C(C(C5(C)C)O)O)O)C)C)C2C1(C)O)C)C(=O)O |
InChI | InChI=1S/C30H48O6/c1-16-10-13-30(24(34)35)15-14-26(4)17(21(30)29(16,7)36)8-9-19-27(26,5)12-11-18-25(2,3)22(32)20(31)23(33)28(18,19)6/h8,16,18-23,31-33,36H,9-15H2,1-7H3,(H,34,35) |
InChI Key | VULLSLYDWNGNKZ-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C30H48O6 |
Molecular Weight | 504.70 g/mol |
Exact Mass | 504.34508925 g/mol |
Topological Polar Surface Area (TPSA) | 118.00 Ų |
XlogP | 4.00 |
120211-98-5 |
1,2,3,19-Tetrahydroxy-12-ursen-28-oic acid |
113558-03-5 |
CID 73554041 |
PD197573 |
FT-0777089 |
B0005-190098 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.86% | 96.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.99% | 95.56% |
CHEMBL2581 | P07339 | Cathepsin D | 91.42% | 98.95% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 90.10% | 91.11% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 88.90% | 96.77% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 85.69% | 82.69% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 85.57% | 97.09% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 84.95% | 91.19% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 84.21% | 93.03% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 84.05% | 90.17% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 82.79% | 100.00% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 81.59% | 93.00% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 81.26% | 92.94% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Agrimonia pilosa |
Eriobotrya japonica |
Rubus ellipticus |
Sanguisorba officinalis |
PubChem | 14312995 |
LOTUS | LTS0236587 |
wikiData | Q105297292 |