(2S)-2-[4-[(2S,3S,4S,5S,6R)-3,4-dihydroxy-6-(hydroxymethyl)-5-[(2S,3S,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxyphenyl]-5,7-dimethoxy-2,3-dihydrochromen-4-one
Internal ID | dffb9c52-4dfc-4aec-b307-b34986fcfae8 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides |
IUPAC Name | (2S)-2-[4-[(2S,3S,4S,5S,6R)-3,4-dihydroxy-6-(hydroxymethyl)-5-[(2S,3S,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxyphenyl]-5,7-dimethoxy-2,3-dihydrochromen-4-one |
SMILES (Canonical) | CC1C(C(C(C(O1)OC2C(OC(C(C2O)O)OC3=CC=C(C=C3)C4CC(=O)C5=C(O4)C=C(C=C5OC)OC)CO)O)O)O |
SMILES (Isomeric) | C[C@H]1[C@@H]([C@H]([C@@H]([C@@H](O1)O[C@@H]2[C@H](O[C@H]([C@H]([C@@H]2O)O)OC3=CC=C(C=C3)[C@@H]4CC(=O)C5=C(O4)C=C(C=C5OC)OC)CO)O)O)O |
InChI | InChI=1S/C29H36O14/c1-12-22(32)23(33)25(35)28(39-12)43-27-20(11-30)42-29(26(36)24(27)34)40-14-6-4-13(5-7-14)17-10-16(31)21-18(38-3)8-15(37-2)9-19(21)41-17/h4-9,12,17,20,22-30,32-36H,10-11H2,1-3H3/t12-,17-,20+,22-,23+,24-,25-,26-,27+,28-,29+/m0/s1 |
InChI Key | HDSXTURQGPCWIN-UBUJWPRQSA-N |
Popularity | 0 references in papers |
Molecular Formula | C29H36O14 |
Molecular Weight | 608.60 g/mol |
Exact Mass | 608.21050582 g/mol |
Topological Polar Surface Area (TPSA) | 203.00 Ų |
XlogP | -1.00 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.94% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.58% | 96.09% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 94.93% | 97.09% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 94.43% | 85.14% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.29% | 86.33% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 93.86% | 94.00% |
CHEMBL4208 | P20618 | Proteasome component C5 | 93.77% | 90.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 92.48% | 89.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.23% | 95.56% |
CHEMBL2581 | P07339 | Cathepsin D | 92.02% | 98.95% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 91.47% | 97.36% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 91.26% | 95.89% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 89.14% | 86.92% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 86.53% | 99.17% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 84.89% | 96.00% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 84.60% | 92.62% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 82.01% | 95.89% |
CHEMBL3401 | O75469 | Pregnane X receptor | 81.81% | 94.73% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 80.96% | 96.21% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Bauhinia variegata |
PubChem | 163074601 |
LOTUS | LTS0146095 |
wikiData | Q105026528 |