9-(1,3-benzodioxol-5-yl)-4-[(2S,3R,4R)-4-hydroxy-4-(hydroxymethyl)-3-[(2S,3R,4S,5S)-3,4,5-trihydroxyoxan-2-yl]oxyoxolan-2-yl]oxy-6,7-dimethoxy-3H-benzo[f][2]benzofuran-1-one
Internal ID | a7204132-ec92-448c-8251-bcf591440c5f |
Taxonomy | Lignans, neolignans and related compounds > Lignan glycosides |
IUPAC Name | 9-(1,3-benzodioxol-5-yl)-4-[(2S,3R,4R)-4-hydroxy-4-(hydroxymethyl)-3-[(2S,3R,4S,5S)-3,4,5-trihydroxyoxan-2-yl]oxyoxolan-2-yl]oxy-6,7-dimethoxy-3H-benzo[f][2]benzofuran-1-one |
SMILES (Canonical) | COC1=C(C=C2C(=C1)C(=C3C(=C2OC4C(C(CO4)(CO)O)OC5C(C(C(CO5)O)O)O)COC3=O)C6=CC7=C(C=C6)OCO7)OC |
SMILES (Isomeric) | COC1=C(C=C2C(=C1)C(=C3C(=C2O[C@H]4[C@@H]([C@](CO4)(CO)O)O[C@H]5[C@@H]([C@H]([C@H](CO5)O)O)O)COC3=O)C6=CC7=C(C=C6)OCO7)OC |
InChI | InChI=1S/C31H32O15/c1-38-19-6-14-15(7-20(19)39-2)26(16-8-40-28(36)23(16)22(14)13-3-4-18-21(5-13)44-12-43-18)45-30-27(31(37,10-32)11-42-30)46-29-25(35)24(34)17(33)9-41-29/h3-7,17,24-25,27,29-30,32-35,37H,8-12H2,1-2H3/t17-,24-,25+,27-,29-,30-,31+/m0/s1 |
InChI Key | HBUCXSOGVZJQHH-IJZDSENBSA-N |
Popularity | 0 references in papers |
Molecular Formula | C31H32O15 |
Molecular Weight | 644.60 g/mol |
Exact Mass | 644.17412031 g/mol |
Topological Polar Surface Area (TPSA) | 201.00 Ų |
XlogP | 0.10 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.64% | 91.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 98.41% | 94.45% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 98.23% | 96.77% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 96.61% | 92.62% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.54% | 95.56% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 96.52% | 85.14% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 96.36% | 86.33% |
CHEMBL2581 | P07339 | Cathepsin D | 96.00% | 98.95% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 95.96% | 94.80% |
CHEMBL2535 | P11166 | Glucose transporter | 95.04% | 98.75% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 94.22% | 89.00% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.62% | 96.09% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 93.44% | 94.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.64% | 97.09% |
CHEMBL4302 | P08183 | P-glycoprotein 1 | 89.75% | 92.98% |
CHEMBL4940 | P07195 | L-lactate dehydrogenase B chain | 88.42% | 95.53% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 88.33% | 100.00% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 87.51% | 96.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.57% | 95.89% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 85.86% | 97.14% |
CHEMBL4208 | P20618 | Proteasome component C5 | 84.22% | 90.00% |
CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 84.16% | 97.28% |
CHEMBL5555 | O00767 | Acyl-CoA desaturase | 81.62% | 97.50% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 81.59% | 99.23% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 80.34% | 91.49% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Garcinia subelliptica |
Justicia procumbens |
PubChem | 163085795 |
LOTUS | LTS0128504 |
wikiData | Q105025486 |