[4,5-Dihydroxy-2-[[7-(hydroxymethyl)-1-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,4a,5,7a-tetrahydrocyclopenta[c]pyran-5-yl]oxy]-6-methyloxan-3-yl] 3-(3-hydroxy-4-methoxyphenyl)prop-2-enoate
| Internal ID | e24625bb-feed-4f19-afb5-86c585e5cd8b |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides > Iridoid O-glycosides |
| IUPAC Name | [4,5-dihydroxy-2-[[7-(hydroxymethyl)-1-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,4a,5,7a-tetrahydrocyclopenta[c]pyran-5-yl]oxy]-6-methyloxan-3-yl] 3-(3-hydroxy-4-methoxyphenyl)prop-2-enoate |
| SMILES (Canonical) | CC1C(C(C(C(O1)OC2C=C(C3C2C=COC3OC4C(C(C(C(O4)CO)O)O)O)CO)OC(=O)C=CC5=CC(=C(C=C5)OC)O)O)O |
| SMILES (Isomeric) | CC1C(C(C(C(O1)OC2C=C(C3C2C=COC3OC4C(C(C(C(O4)CO)O)O)O)CO)OC(=O)C=CC5=CC(=C(C=C5)OC)O)O)O |
| InChI | InChI=1S/C31H40O16/c1-13-23(36)26(39)28(46-21(35)6-4-14-3-5-18(41-2)17(34)9-14)31(43-13)44-19-10-15(11-32)22-16(19)7-8-42-29(22)47-30-27(40)25(38)24(37)20(12-33)45-30/h3-10,13,16,19-20,22-34,36-40H,11-12H2,1-2H3 |
| InChI Key | VMKDGEXOTBXACB-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C31H40O16 |
| Molecular Weight | 668.60 g/mol |
| Exact Mass | 668.23163518 g/mol |
| Topological Polar Surface Area (TPSA) | 244.00 Ų |
| XlogP | -1.80 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.29% | 91.11% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 97.63% | 86.33% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.94% | 96.09% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 96.80% | 96.00% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 95.96% | 89.00% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 94.76% | 91.49% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.93% | 95.56% |
| CHEMBL3194 | P02766 | Transthyretin | 91.33% | 90.71% |
| CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 89.61% | 97.36% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 88.65% | 99.17% |
| CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 87.47% | 86.92% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 84.05% | 90.00% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 83.97% | 92.94% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 83.04% | 94.73% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 82.52% | 91.71% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 81.41% | 95.50% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 81.36% | 95.89% |
| CHEMBL2085 | P14174 | Macrophage migration inhibitory factor | 80.93% | 80.78% |
| CHEMBL4829 | O00763 | Acetyl-CoA carboxylase 2 | 80.88% | 98.00% |
| CHEMBL2581 | P07339 | Cathepsin D | 80.52% | 98.95% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 80.07% | 97.09% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Verbascum nigrum |
| PubChem | 75061254 |
| LOTUS | LTS0205076 |
| wikiData | Q105289028 |