(2R,3R)-2-(3,5-dihydroxy-4-methoxyphenyl)-8-[(2R,3R,4R)-2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-3,4-dihydro-2H-chromen-4-yl]-3,4-dihydro-2H-chromene-3,5,7-triol
Internal ID | 1191aa4f-c1d2-4644-a059-cbfcb6b0dd94 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Biflavonoids and polyflavonoids |
IUPAC Name | (2R,3R)-2-(3,5-dihydroxy-4-methoxyphenyl)-8-[(2R,3R,4R)-2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-3,4-dihydro-2H-chromen-4-yl]-3,4-dihydro-2H-chromene-3,5,7-triol |
SMILES (Canonical) | COC1=C(C=C(C=C1O)C2C(CC3=C(O2)C(=C(C=C3O)O)C4C(C(OC5=CC(=CC(=C45)O)O)C6=CC(=C(C=C6)O)O)O)O)O |
SMILES (Isomeric) | COC1=C(C=C(C=C1O)[C@@H]2[C@@H](CC3=C(O2)C(=C(C=C3O)O)[C@@H]4[C@H]([C@H](OC5=CC(=CC(=C45)O)O)C6=CC(=C(C=C6)O)O)O)O)O |
InChI | InChI=1S/C31H28O13/c1-42-31-20(38)5-12(6-21(31)39)28-22(40)9-14-16(34)10-19(37)25(30(14)44-28)26-24-18(36)7-13(32)8-23(24)43-29(27(26)41)11-2-3-15(33)17(35)4-11/h2-8,10,22,26-29,32-41H,9H2,1H3/t22-,26-,27-,28-,29-/m1/s1 |
InChI Key | ADKHKBZKHGJXDZ-NFJBMHMQSA-N |
Popularity | 0 references in papers |
Molecular Formula | C31H28O13 |
Molecular Weight | 608.50 g/mol |
Exact Mass | 608.15299094 g/mol |
Topological Polar Surface Area (TPSA) | 230.00 Ų |
XlogP | 2.30 |
There are no found synonyms. |
![2D Structure of (2R,3R)-2-(3,5-dihydroxy-4-methoxyphenyl)-8-[(2R,3R,4R)-2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-3,4-dihydro-2H-chromen-4-yl]-3,4-dihydro-2H-chromene-3,5,7-triol 2D Structure of (2R,3R)-2-(3,5-dihydroxy-4-methoxyphenyl)-8-[(2R,3R,4R)-2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-3,4-dihydro-2H-chromen-4-yl]-3,4-dihydro-2H-chromene-3,5,7-triol](https://plantaedb.com/storage/docs/compounds/2023/11/51c16750-8629-11ee-92d4-e17f690e695b.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.62% | 91.11% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 98.96% | 83.82% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.32% | 96.09% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.49% | 97.09% |
CHEMBL2535 | P11166 | Glucose transporter | 92.08% | 98.75% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 89.08% | 99.15% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.78% | 89.00% |
CHEMBL4208 | P20618 | Proteasome component C5 | 88.31% | 90.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.27% | 94.45% |
CHEMBL1929 | P47989 | Xanthine dehydrogenase | 86.68% | 96.12% |
CHEMBL236 | P41143 | Delta opioid receptor | 86.08% | 99.35% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 86.05% | 91.49% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.71% | 95.56% |
CHEMBL3401 | O75469 | Pregnane X receptor | 84.56% | 94.73% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 82.99% | 86.33% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 82.01% | 99.17% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 81.41% | 94.00% |
CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 81.16% | 82.38% |
CHEMBL2581 | P07339 | Cathepsin D | 81.13% | 98.95% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Gymnosporia senegalensis |
PubChem | 10416271 |
LOTUS | LTS0155316 |
wikiData | Q104909636 |