[(1R,3S,4R,5S,8R,9Z,13R,15S)-15-hydroxy-5-methyl-6-oxo-7,14,16-trioxatetracyclo[8.4.3.01,13.04,8]heptadec-9-en-3-yl] 2-methylprop-2-enoate
Internal ID | cad3be28-db7f-49a0-a54d-76ea330823ad |
Taxonomy | Organoheterocyclic compounds > Lactones > Gamma butyrolactones |
IUPAC Name | [(1R,3S,4R,5S,8R,9Z,13R,15S)-15-hydroxy-5-methyl-6-oxo-7,14,16-trioxatetracyclo[8.4.3.01,13.04,8]heptadec-9-en-3-yl] 2-methylprop-2-enoate |
SMILES (Canonical) | CC1C2C(CC34C(O3)CCC(=CC2OC1=O)COC4O)OC(=O)C(=C)C |
SMILES (Isomeric) | C[C@H]1[C@@H]2[C@H](C[C@]34[C@H](O3)CC/C(=C/[C@H]2OC1=O)/CO[C@@H]4O)OC(=O)C(=C)C |
InChI | InChI=1S/C19H24O7/c1-9(2)16(20)25-13-7-19-14(26-19)5-4-11(8-23-18(19)22)6-12-15(13)10(3)17(21)24-12/h6,10,12-15,18,22H,1,4-5,7-8H2,2-3H3/b11-6-/t10-,12+,13-,14+,15-,18-,19+/m0/s1 |
InChI Key | FJHYOVJXDRUWEY-UMGCXCHVSA-N |
Popularity | 0 references in papers |
Molecular Formula | C19H24O7 |
Molecular Weight | 364.40 g/mol |
Exact Mass | 364.15220310 g/mol |
Topological Polar Surface Area (TPSA) | 94.60 Ų |
XlogP | 1.00 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.57% | 91.11% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 92.74% | 91.49% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.00% | 96.09% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.87% | 89.00% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 88.05% | 91.19% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 86.35% | 100.00% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 86.14% | 99.23% |
CHEMBL2581 | P07339 | Cathepsin D | 85.49% | 98.95% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 85.23% | 92.94% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 84.82% | 94.45% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.08% | 95.56% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 83.01% | 97.09% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 82.48% | 85.14% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 80.07% | 97.14% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Celosia argentea |
Gymnanthemum amygdalinum |
PubChem | 163076706 |
LOTUS | LTS0200041 |
wikiData | Q104917396 |