[(1S,2S,6S,9S,10S,11R,12S,13S,14S,15R,16S,17R,18R,19S,22R,23S,25R)-16,17-diacetyloxy-10,12,14,23-tetrahydroxy-6,10,19-trimethyl-13-[(2R)-2-methylbutanoyl]oxy-24-oxa-4-azaheptacyclo[12.12.0.02,11.04,9.015,25.018,23.019,25]hexacosan-22-yl] (2S)-2-hydroxy-2-methylbutanoate
Internal ID | 23df5294-143b-4c4c-b240-811c863be230 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal alkaloids > Cerveratrum-type alkaloids |
IUPAC Name | [(1S,2S,6S,9S,10S,11R,12S,13S,14S,15R,16S,17R,18R,19S,22R,23S,25R)-16,17-diacetyloxy-10,12,14,23-tetrahydroxy-6,10,19-trimethyl-13-[(2R)-2-methylbutanoyl]oxy-24-oxa-4-azaheptacyclo[12.12.0.02,11.04,9.015,25.018,23.019,25]hexacosan-22-yl] (2S)-2-hydroxy-2-methylbutanoate |
SMILES (Canonical) | CCC(C)C(=O)OC1C(C2C(CN3CC(CCC3C2(C)O)C)C4C1(C5C(C(C6C7(C5(C4)OC6(C(CC7)OC(=O)C(C)(CC)O)O)C)OC(=O)C)OC(=O)C)O)O |
SMILES (Isomeric) | CC[C@@H](C)C(=O)O[C@H]1[C@H]([C@H]2[C@@H](CN3C[C@H](CC[C@H]3[C@@]2(C)O)C)[C@H]4[C@@]1([C@H]5[C@@H]([C@@H]([C@H]6[C@]7([C@]5(C4)O[C@@]6([C@@H](CC7)OC(=O)[C@](C)(CC)O)O)C)OC(=O)C)OC(=O)C)O)O |
InChI | InChI=1S/C41H63NO14/c1-10-20(4)34(46)55-33-28(45)27-23(18-42-17-19(3)12-13-25(42)38(27,9)49)24-16-39-32(40(24,33)50)30(53-22(6)44)29(52-21(5)43)31-36(39,7)15-14-26(41(31,51)56-39)54-35(47)37(8,48)11-2/h19-20,23-33,45,48-51H,10-18H2,1-9H3/t19-,20+,23-,24-,25-,26+,27+,28-,29-,30+,31-,32-,33-,36-,37-,38+,39+,40-,41+/m0/s1 |
InChI Key | HYTGGNIMZXFORS-QOHCVCCNSA-N |
Popularity | 0 references in papers |
Molecular Formula | C41H63NO14 |
Molecular Weight | 793.90 g/mol |
Exact Mass | 793.42485568 g/mol |
Topological Polar Surface Area (TPSA) | 219.00 Ų |
XlogP | 2.10 |
There are no found synonyms. |
![2D Structure of [(1S,2S,6S,9S,10S,11R,12S,13S,14S,15R,16S,17R,18R,19S,22R,23S,25R)-16,17-diacetyloxy-10,12,14,23-tetrahydroxy-6,10,19-trimethyl-13-[(2R)-2-methylbutanoyl]oxy-24-oxa-4-azaheptacyclo[12.12.0.02,11.04,9.015,25.018,23.019,25]hexacosan-22-yl] (2S)-2-hydroxy-2-methylbutanoate 2D Structure of [(1S,2S,6S,9S,10S,11R,12S,13S,14S,15R,16S,17R,18R,19S,22R,23S,25R)-16,17-diacetyloxy-10,12,14,23-tetrahydroxy-6,10,19-trimethyl-13-[(2R)-2-methylbutanoyl]oxy-24-oxa-4-azaheptacyclo[12.12.0.02,11.04,9.015,25.018,23.019,25]hexacosan-22-yl] (2S)-2-hydroxy-2-methylbutanoate](https://plantaedb.com/storage/docs/compounds/2023/11/50212f00-8724-11ee-b8fc-3761b824bf64.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 99.95% | 97.25% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.16% | 96.09% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 98.57% | 96.77% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 98.22% | 85.14% |
CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 97.54% | 89.05% |
CHEMBL2581 | P07339 | Cathepsin D | 95.10% | 98.95% |
CHEMBL1914 | P06276 | Butyrylcholinesterase | 94.34% | 95.00% |
CHEMBL2815 | P04629 | Nerve growth factor receptor Trk-A | 92.09% | 87.16% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 91.91% | 97.14% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 91.50% | 96.61% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 91.29% | 96.47% |
CHEMBL2534 | O15530 | 3-phosphoinositide dependent protein kinase-1 | 91.20% | 95.36% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 91.01% | 95.89% |
CHEMBL1293316 | Q9HBX9 | Relaxin receptor 1 | 90.68% | 82.50% |
CHEMBL5888 | Q99558 | Mitogen-activated protein kinase kinase kinase 14 | 90.58% | 100.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.17% | 94.45% |
CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 90.16% | 97.28% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.81% | 86.33% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 89.69% | 82.69% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 89.07% | 97.79% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 88.35% | 100.00% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 87.70% | 93.56% |
CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 87.22% | 89.50% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 86.71% | 100.00% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 86.23% | 92.50% |
CHEMBL3746 | P80365 | 11-beta-hydroxysteroid dehydrogenase 2 | 86.16% | 94.78% |
CHEMBL2095194 | P08709 | Coagulation factor VII/tissue factor | 86.16% | 99.17% |
CHEMBL299 | P17252 | Protein kinase C alpha | 86.16% | 98.03% |
CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 85.50% | 91.03% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.89% | 95.89% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 84.73% | 100.00% |
CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 84.64% | 96.90% |
CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 84.40% | 98.75% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.34% | 97.09% |
CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 84.14% | 95.71% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.89% | 89.00% |
CHEMBL3437 | Q16853 | Amine oxidase, copper containing | 82.72% | 94.00% |
CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 82.60% | 97.29% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 82.23% | 93.04% |
CHEMBL2094135 | Q96BI3 | Gamma-secretase | 80.84% | 98.05% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 80.78% | 92.62% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 80.70% | 91.11% |
CHEMBL2007625 | O75874 | Isocitrate dehydrogenase [NADP] cytoplasmic | 80.67% | 99.00% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 80.42% | 95.50% |
CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 80.38% | 95.71% |
CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 80.36% | 97.50% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 80.28% | 94.00% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 80.19% | 93.00% |
CHEMBL1163125 | O60885 | Bromodomain-containing protein 4 | 80.00% | 97.31% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Veratrum nigrum |
PubChem | 162916728 |
LOTUS | LTS0081397 |
wikiData | Q105035467 |