5-Styrylresorcinol
| Internal ID | a426377e-79e4-4aac-816f-5e513821f6a2 |
| Taxonomy | Phenylpropanoids and polyketides > Stilbenes |
| IUPAC Name | 5-(2-phenylethenyl)benzene-1,3-diol |
| SMILES (Canonical) | C1=CC=C(C=C1)C=CC2=CC(=CC(=C2)O)O |
| SMILES (Isomeric) | C1=CC=C(C=C1)C=CC2=CC(=CC(=C2)O)O |
| InChI | InChI=1S/C14H12O2/c15-13-8-12(9-14(16)10-13)7-6-11-4-2-1-3-5-11/h1-10,15-16H |
| InChI Key | YCVPRTHEGLPYPB-UHFFFAOYSA-N |
| Popularity | 94 references in papers |
| Molecular Formula | C14H12O2 |
| Molecular Weight | 212.24 g/mol |
| Exact Mass | 212.083729621 g/mol |
| Topological Polar Surface Area (TPSA) | 40.50 Ų |
| XlogP | 3.50 |
| 3,5-Dihydroxystilbene |
| 5-(2-phenylethenyl)benzene-1,3-diol |
| 5-(2-phenylethenyl)-1,3-benzenediol |
| Spectrum_000651 |
| Resorcinol, 5-styryl- |
| SpecPlus_000075 |
| Spectrum2_000193 |
| Spectrum3_000197 |
| Spectrum4_001514 |
| KBioGR_002207 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.62% | 91.11% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 94.95% | 94.62% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.48% | 95.56% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.24% | 86.33% |
| CHEMBL3194 | P02766 | Transthyretin | 90.62% | 90.71% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 90.23% | 96.00% |
| CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 86.11% | 94.08% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 85.62% | 91.71% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 81.96% | 94.73% |
| CHEMBL2581 | P07339 | Cathepsin D | 81.69% | 98.95% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 80.70% | 91.49% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Alnus pendula |
| Alnus sieboldiana |
| Cryptocarya obovata |
| Helichrysum chionosphaerum |
| Nothofagus fusca |
| Pinus ponderosa |
| Pinus radiata |
| Pinus sibirica |
| Pinus sylvestris |
| Vitis vinifera |
| PubChem | 100754 |
| LOTUS | LTS0183107 |
| wikiData | Q23820208 |