5-Methylquinoxaline
| Internal ID | d30e05c7-7823-4556-ae15-31a80c43d905 |
| Taxonomy | Organoheterocyclic compounds > Diazanaphthalenes > Benzodiazines > Quinoxalines |
| IUPAC Name | 5-methylquinoxaline |
| SMILES (Canonical) | CC1=C2C(=CC=C1)N=CC=N2 |
| SMILES (Isomeric) | CC1=C2C(=CC=C1)N=CC=N2 |
| InChI | InChI=1S/C9H8N2/c1-7-3-2-4-8-9(7)11-6-5-10-8/h2-6H,1H3 |
| InChI Key | CQLOYHZZZCWHSG-UHFFFAOYSA-N |
| Popularity | 27 references in papers |
| Molecular Formula | C9H8N2 |
| Molecular Weight | 144.17 g/mol |
| Exact Mass | 144.068748264 g/mol |
| Topological Polar Surface Area (TPSA) | 25.80 Ų |
| XlogP | 2.00 |
| 13708-12-8 |
| Quinoxaline, 5-methyl- |
| FEMA No. 3203 |
| 5-Methyl-Quinoxaline |
| MFCD00012335 |
| L0AD7T152G |
| DTXSID4047090 |
| 5-methyl quinoxaline |
| EINECS 237-246-5 |
| UNII-L0AD7T152G |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3401 | O75469 | Pregnane X receptor | 91.27% | 94.73% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.87% | 86.33% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 86.00% | 93.65% |
| CHEMBL1868 | P17948 | Vascular endothelial growth factor receptor 1 | 85.44% | 96.47% |
| CHEMBL5014 | O43353 | Serine/threonine-protein kinase RIPK2 | 84.34% | 86.79% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 82.69% | 93.10% |
| CHEMBL2535 | P11166 | Glucose transporter | 82.42% | 98.75% |
| CHEMBL2581 | P07339 | Cathepsin D | 82.34% | 98.95% |
| CHEMBL3902 | P09211 | Glutathione S-transferase Pi | 81.94% | 93.81% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 81.20% | 94.00% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 80.62% | 96.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 80.55% | 95.56% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Coffea arabica |
| PubChem | 61670 |
| LOTUS | LTS0039418 |
| wikiData | Q27225666 |