5-methoxy-3-methyl-9H-carbazol-2-ol
| Internal ID | 90b91dac-bfa7-4067-819e-318b2cd630bb |
| Taxonomy | Organoheterocyclic compounds > Indoles and derivatives > Carbazoles |
| IUPAC Name | 5-methoxy-3-methyl-9H-carbazol-2-ol |
| SMILES (Canonical) | CC1=CC2=C(C=C1O)NC3=C2C(=CC=C3)OC |
| SMILES (Isomeric) | CC1=CC2=C(C=C1O)NC3=C2C(=CC=C3)OC |
| InChI | InChI=1S/C14H13NO2/c1-8-6-9-11(7-12(8)16)15-10-4-3-5-13(17-2)14(9)10/h3-7,15-16H,1-2H3 |
| InChI Key | IARIWKRWSRIQSJ-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C14H13NO2 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.094628657 g/mol |
| Topological Polar Surface Area (TPSA) | 45.20 Ų |
| XlogP | 3.40 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2535 | P11166 | Glucose transporter | 96.38% | 98.75% |
| CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 95.85% | 91.79% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 95.47% | 94.45% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.37% | 91.11% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 95.11% | 93.99% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.56% | 95.56% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 91.65% | 94.00% |
| CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 91.62% | 95.56% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.22% | 86.33% |
| CHEMBL2581 | P07339 | Cathepsin D | 89.32% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 89.24% | 96.09% |
| CHEMBL4355 | O14976 | Serine/threonine-protein kinase GAK | 88.31% | 89.32% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 88.03% | 94.75% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 87.50% | 89.62% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 85.37% | 91.71% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 83.58% | 93.31% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 83.12% | 99.15% |
| CHEMBL2146302 | O94925 | Glutaminase kidney isoform, mitochondrial | 83.00% | 100.00% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 82.39% | 90.20% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.93% | 89.00% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 81.75% | 92.94% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 80.47% | 97.21% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Glycosmis parviflora |
| PubChem | 10376445 |
| LOTUS | LTS0084794 |
| wikiData | Q105036253 |