5-Methoxy-2-(4-methoxyphenyl)chromen-7-one
| Internal ID | e5d7ca93-704c-4928-9327-d97af2b2e505 |
| Taxonomy | Phenylpropanoids and polyketides > Flavonoids > O-methylated flavonoids > 5-O-methylated flavonoids |
| IUPAC Name | 5-methoxy-2-(4-methoxyphenyl)chromen-7-one |
| SMILES (Canonical) | COC1=CC=C(C=C1)C2=CC=C3C(=CC(=O)C=C3OC)O2 |
| SMILES (Isomeric) | COC1=CC=C(C=C1)C2=CC=C3C(=CC(=O)C=C3OC)O2 |
| InChI | InChI=1S/C17H14O4/c1-19-13-5-3-11(4-6-13)15-8-7-14-16(20-2)9-12(18)10-17(14)21-15/h3-10H,1-2H3 |
| InChI Key | QWKKIZJQYRIBHF-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C17H14O4 |
| Molecular Weight | 282.29 g/mol |
| Exact Mass | 282.08920892 g/mol |
| Topological Polar Surface Area (TPSA) | 44.80 Ų |
| XlogP | 2.30 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL1907 | P15144 | Aminopeptidase N | 97.18% | 93.31% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 96.62% | 94.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.95% | 95.56% |
| CHEMBL2581 | P07339 | Cathepsin D | 93.75% | 98.95% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.41% | 86.33% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 91.21% | 91.11% |
| CHEMBL5747 | Q92793 | CREB-binding protein | 89.71% | 95.12% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 87.51% | 96.00% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 87.28% | 85.14% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 86.74% | 99.15% |
| CHEMBL1293294 | P51151 | Ras-related protein Rab-9A | 86.36% | 87.67% |
| CHEMBL1293277 | O15118 | Niemann-Pick C1 protein | 86.18% | 81.11% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 86.07% | 99.17% |
| CHEMBL2208 | P49137 | MAP kinase-activated protein kinase 2 | 85.31% | 95.20% |
| CHEMBL4940 | P07195 | L-lactate dehydrogenase B chain | 84.02% | 95.53% |
| CHEMBL1966 | Q02127 | Dihydroorotate dehydrogenase | 83.91% | 96.09% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 83.27% | 90.00% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 82.35% | 96.95% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 80.78% | 89.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Imperata cylindrica |
| PubChem | 162910514 |
| LOTUS | LTS0080897 |
| wikiData | Q105229236 |