5'-Isovaleryloxymethyl-5-(4-isovaleryloxy-but-1-ynyl)-2,2'-bithiophene
Internal ID | d3008be7-30f7-49ed-b4a1-69545d9235e2 |
Taxonomy | Organoheterocyclic compounds > Bi- and oligothiophenes |
IUPAC Name | 4-[5-[5-(3-methylbutanoyloxymethyl)thiophen-2-yl]thiophen-2-yl]but-3-ynyl 3-methylbutanoate |
SMILES (Canonical) | CC(C)CC(=O)OCCC#CC1=CC=C(S1)C2=CC=C(S2)COC(=O)CC(C)C |
SMILES (Isomeric) | CC(C)CC(=O)OCCC#CC1=CC=C(S1)C2=CC=C(S2)COC(=O)CC(C)C |
InChI | InChI=1S/C23H28O4S2/c1-16(2)13-22(24)26-12-6-5-7-18-8-10-20(28-18)21-11-9-19(29-21)15-27-23(25)14-17(3)4/h8-11,16-17H,6,12-15H2,1-4H3 |
InChI Key | KWTCTHJCQNSERL-UHFFFAOYSA-N |
Popularity | 2 references in papers |
Molecular Formula | C23H28O4S2 |
Molecular Weight | 432.60 g/mol |
Exact Mass | 432.14290172 g/mol |
Topological Polar Surface Area (TPSA) | 109.00 Ų |
XlogP | 5.80 |
BDBM50035706 |
5'-isovaleryloxymethyl-5-(4-isovaleryloxy-but-1-ynyl)-2,2'-bithiophene |
![2D Structure of 5'-Isovaleryloxymethyl-5-(4-isovaleryloxy-but-1-ynyl)-2,2'-bithiophene 2D Structure of 5'-Isovaleryloxymethyl-5-(4-isovaleryloxy-but-1-ynyl)-2,2'-bithiophene](https://plantaedb.com/storage/docs/compounds/2023/11/5-isovaleryloxymethyl-5-4-isovaleryloxy-but-1-ynyl-22-bithiophene.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL284 | P27487 | Dipeptidyl peptidase IV |
750 nM |
IC50 |
via Super-PRED
|
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.48% | 96.09% |
CHEMBL3401 | O75469 | Pregnane X receptor | 91.61% | 94.73% |
CHEMBL2581 | P07339 | Cathepsin D | 90.68% | 98.95% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 87.53% | 99.17% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.59% | 86.33% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 85.11% | 95.93% |
CHEMBL3975 | P09467 | Fructose-1,6-bisphosphatase | 83.96% | 92.95% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 83.13% | 91.11% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 82.61% | 94.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Eclipta prostrata |
PubChem | 13939278 |
LOTUS | LTS0164335 |
wikiData | Q105147097 |