5-hydroxy-8-[(2R)-2-hydroxy-3-methylbut-3-enyl]-7-methoxy-2-methylchromen-4-one
| Internal ID | 325aeedf-f706-4bfb-82e8-073d35a173e9 |
| Taxonomy | Organoheterocyclic compounds > Benzopyrans > 1-benzopyrans > Chromones |
| IUPAC Name | 5-hydroxy-8-[(2R)-2-hydroxy-3-methylbut-3-enyl]-7-methoxy-2-methylchromen-4-one |
| SMILES (Canonical) | CC1=CC(=O)C2=C(O1)C(=C(C=C2O)OC)CC(C(=C)C)O |
| SMILES (Isomeric) | CC1=CC(=O)C2=C(O1)C(=C(C=C2O)OC)C[C@H](C(=C)C)O |
| InChI | InChI=1S/C16H18O5/c1-8(2)11(17)6-10-14(20-4)7-13(19)15-12(18)5-9(3)21-16(10)15/h5,7,11,17,19H,1,6H2,2-4H3/t11-/m1/s1 |
| InChI Key | HPHRKLAQYUCXBZ-LLVKDONJSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C16H18O5 |
| Molecular Weight | 290.31 g/mol |
| Exact Mass | 290.11542367 g/mol |
| Topological Polar Surface Area (TPSA) | 76.00 Ų |
| XlogP | 3.00 |
| There are no found synonyms. |
![2D Structure of 5-hydroxy-8-[(2R)-2-hydroxy-3-methylbut-3-enyl]-7-methoxy-2-methylchromen-4-one](https://plantaedb.com/storage/docs/compounds/2023/11/5-hydroxy-8-2r-2-hydroxy-3-methylbut-3-enyl-7-methoxy-2-methylchromen-4-one.jpg "2D Structure of 5-hydroxy-8-[(2R)-2-hydroxy-3-methylbut-3-enyl]-7-methoxy-2-methylchromen-4-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.85% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 95.45% | 98.95% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 93.42% | 94.73% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 93.41% | 94.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.31% | 95.56% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.75% | 89.00% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 89.75% | 85.14% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.70% | 94.45% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.55% | 86.33% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 87.27% | 99.17% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 85.40% | 96.95% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 83.52% | 97.21% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 81.39% | 90.20% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 81.37% | 94.75% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 80.59% | 95.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Harrisonia perforata |
| PubChem | 163020136 |
| LOTUS | LTS0218736 |
| wikiData | Q105031703 |