5-Hydroxy-7-methoxy-10-phenyl-3-oxatricyclo[7.3.1.05,13]trideca-1(13),6,9,11-tetraene-2,8-dione
Internal ID | 5d5a6a6a-2203-4f11-bb3a-79e30a6f84bb |
Taxonomy | Benzenoids > Naphthalenes |
IUPAC Name | 5-hydroxy-7-methoxy-10-phenyl-3-oxatricyclo[7.3.1.05,13]trideca-1(13),6,9,11-tetraene-2,8-dione |
SMILES (Canonical) | COC1=CC2(COC(=O)C3=C2C(=C(C=C3)C4=CC=CC=C4)C1=O)O |
SMILES (Isomeric) | COC1=CC2(COC(=O)C3=C2C(=C(C=C3)C4=CC=CC=C4)C1=O)O |
InChI | InChI=1S/C19H14O5/c1-23-14-9-19(22)10-24-18(21)13-8-7-12(11-5-3-2-4-6-11)15(16(13)19)17(14)20/h2-9,22H,10H2,1H3 |
InChI Key | LVYFZQLYYPOWQS-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C19H14O5 |
Molecular Weight | 322.30 g/mol |
Exact Mass | 322.08412354 g/mol |
Topological Polar Surface Area (TPSA) | 72.80 Ų |
XlogP | 2.40 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 97.75% | 98.95% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 97.52% | 95.56% |
CHEMBL230 | P35354 | Cyclooxygenase-2 | 96.19% | 89.63% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 95.25% | 86.33% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 91.61% | 99.23% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.27% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 89.42% | 91.11% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 88.01% | 97.14% |
CHEMBL262 | P49841 | Glycogen synthase kinase-3 beta | 87.43% | 95.72% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 86.30% | 96.00% |
CHEMBL1907 | P15144 | Aminopeptidase N | 84.47% | 93.31% |
CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 84.35% | 96.67% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.43% | 89.00% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 82.46% | 96.77% |
CHEMBL5028 | O14672 | ADAM10 | 80.97% | 97.50% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 80.68% | 95.93% |
CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 80.16% | 94.08% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 80.15% | 93.99% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Xiphidium caeruleum |
PubChem | 11056366 |
LOTUS | LTS0151800 |
wikiData | Q105158129 |