5-Hydroxy-6,8,10-trimethoxy-2,3-dimethyl-2,3-dihydrobenzo[g]chromen-4-one
Internal ID | abba3d18-1f40-40bc-abd7-fd951523e1d6 |
Taxonomy | Organoheterocyclic compounds > Naphthopyrans > Naphthopyranones |
IUPAC Name | 5-hydroxy-6,8,10-trimethoxy-2,3-dimethyl-2,3-dihydrobenzo[g]chromen-4-one |
SMILES (Canonical) | CC1C(OC2=C(C3=C(C(=CC(=C3)OC)OC)C(=C2C1=O)O)OC)C |
SMILES (Isomeric) | CC1C(OC2=C(C3=C(C(=CC(=C3)OC)OC)C(=C2C1=O)O)OC)C |
InChI | InChI=1S/C18H20O6/c1-8-9(2)24-18-14(15(8)19)16(20)13-11(17(18)23-5)6-10(21-3)7-12(13)22-4/h6-9,20H,1-5H3 |
InChI Key | KRQMXQZQIPIILU-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C18H20O6 |
Molecular Weight | 332.30 g/mol |
Exact Mass | 332.12598835 g/mol |
Topological Polar Surface Area (TPSA) | 74.20 Ų |
XlogP | 3.70 |
There are no found synonyms. |
![2D Structure of 5-Hydroxy-6,8,10-trimethoxy-2,3-dimethyl-2,3-dihydrobenzo[g]chromen-4-one 2D Structure of 5-Hydroxy-6,8,10-trimethoxy-2,3-dimethyl-2,3-dihydrobenzo[g]chromen-4-one](https://plantaedb.com/storage/docs/compounds/2023/11/5-hydroxy-6810-trimethoxy-23-dimethyl-23-dihydrobenzogchromen-4-one.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.39% | 91.11% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 93.60% | 94.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.29% | 95.56% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 91.69% | 85.14% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.48% | 94.45% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 89.04% | 99.15% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.37% | 89.00% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 87.85% | 99.23% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.78% | 86.33% |
CHEMBL2535 | P11166 | Glucose transporter | 84.98% | 98.75% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 84.65% | 99.17% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 84.60% | 96.09% |
CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 81.40% | 94.42% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 80.08% | 92.94% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Harrisonia perforata |
PubChem | 22297191 |
LOTUS | LTS0203542 |
wikiData | Q104938563 |