5-Hydroxy-6-methoxybenzo[f][1]benzofuran-4,9-dione
Internal ID | 45167342-5520-4569-b04e-277a4d71f9ab |
Taxonomy | Organoheterocyclic compounds > Naphthofurans |
IUPAC Name | 5-hydroxy-6-methoxybenzo[f][1]benzofuran-4,9-dione |
SMILES (Canonical) | COC1=C(C2=C(C=C1)C(=O)C3=C(C2=O)C=CO3)O |
SMILES (Isomeric) | COC1=C(C2=C(C=C1)C(=O)C3=C(C2=O)C=CO3)O |
InChI | InChI=1S/C13H8O5/c1-17-8-3-2-6-9(12(8)16)10(14)7-4-5-18-13(7)11(6)15/h2-5,16H,1H3 |
InChI Key | XPDSROSZHJSDFW-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C13H8O5 |
Molecular Weight | 244.20 g/mol |
Exact Mass | 244.03717335 g/mol |
Topological Polar Surface Area (TPSA) | 76.70 Ų |
XlogP | 2.40 |
There are no found synonyms. |
![2D Structure of 5-Hydroxy-6-methoxybenzo[f][1]benzofuran-4,9-dione 2D Structure of 5-Hydroxy-6-methoxybenzo[f][1]benzofuran-4,9-dione](https://plantaedb.com/storage/docs/compounds/2023/11/5-hydroxy-6-methoxybenzof1benzofuran-49-dione.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL1951 | P21397 | Monoamine oxidase A | 98.53% | 91.49% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.16% | 91.11% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.66% | 95.56% |
CHEMBL2581 | P07339 | Cathepsin D | 92.65% | 98.95% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 90.90% | 94.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.92% | 89.00% |
CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 85.41% | 96.67% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.69% | 86.33% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 84.57% | 96.00% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 83.44% | 96.09% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 83.31% | 99.23% |
CHEMBL2002 | P12268 | Inosine-5'-monophosphate dehydrogenase 2 | 82.33% | 98.21% |
CHEMBL1255126 | O15151 | Protein Mdm4 | 81.00% | 90.20% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.67% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Lantana camara |
PubChem | 14890476 |
LOTUS | LTS0074706 |
wikiData | Q105338209 |