5-Hydroxy-3-[(4-hydroxyphenyl)methyl]-6,7,8-trimethoxy-2,3-dihydrochromen-4-one
| Internal ID | 6810cc30-6b5e-4a1d-9584-9ba965b42fe2 |
| Taxonomy | Phenylpropanoids and polyketides > Homoisoflavonoids > Homoisoflavans > Homoisoflavanones |
| IUPAC Name | 5-hydroxy-3-[(4-hydroxyphenyl)methyl]-6,7,8-trimethoxy-2,3-dihydrochromen-4-one |
| SMILES (Canonical) | COC1=C(C(=C2C(=C1O)C(=O)C(CO2)CC3=CC=C(C=C3)O)OC)OC |
| SMILES (Isomeric) | COC1=C(C(=C2C(=C1O)C(=O)C(CO2)CC3=CC=C(C=C3)O)OC)OC |
| InChI | InChI=1S/C19H20O7/c1-23-17-15(22)13-14(21)11(8-10-4-6-12(20)7-5-10)9-26-16(13)18(24-2)19(17)25-3/h4-7,11,20,22H,8-9H2,1-3H3 |
| InChI Key | SZCVKSHTEKEQNX-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C19H20O7 |
| Molecular Weight | 360.40 g/mol |
| Exact Mass | 360.12090297 g/mol |
| Topological Polar Surface Area (TPSA) | 94.40 Ų |
| XlogP | 3.10 |
| There are no found synonyms. |
![2D Structure of 5-Hydroxy-3-[(4-hydroxyphenyl)methyl]-6,7,8-trimethoxy-2,3-dihydrochromen-4-one](https://plantaedb.com/storage/docs/compounds/2023/11/5-hydroxy-3-4-hydroxyphenylmethyl-678-trimethoxy-23-dihydrochromen-4-one.jpg "2D Structure of 5-Hydroxy-3-[(4-hydroxyphenyl)methyl]-6,7,8-trimethoxy-2,3-dihydrochromen-4-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.15% | 91.11% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 95.98% | 94.45% |
| CHEMBL2581 | P07339 | Cathepsin D | 95.73% | 98.95% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 90.65% | 94.00% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.01% | 96.09% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.58% | 97.09% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.41% | 95.89% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.07% | 95.56% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 86.90% | 99.17% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.88% | 86.33% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 84.89% | 83.82% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 84.12% | 95.89% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 82.12% | 93.10% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Veltheimia capensis |
| PubChem | 54332197 |
| LOTUS | LTS0076502 |
| wikiData | Q105263999 |