5-Hydroxy-2-methoxyxanthone
| Internal ID | 377ce691-a4e4-40b7-bc94-4d1ff9b4842a |
| Taxonomy | Organoheterocyclic compounds > Benzopyrans > 1-benzopyrans > Xanthones |
| IUPAC Name | 5-hydroxy-2-methoxyxanthen-9-one |
| SMILES (Canonical) | COC1=CC2=C(C=C1)OC3=C(C2=O)C=CC=C3O |
| SMILES (Isomeric) | COC1=CC2=C(C=C1)OC3=C(C2=O)C=CC=C3O |
| InChI | InChI=1S/C14H10O4/c1-17-8-5-6-12-10(7-8)13(16)9-3-2-4-11(15)14(9)18-12/h2-7,15H,1H3 |
| InChI Key | HEOWOJWZMKMTLX-UHFFFAOYSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C14H10O4 |
| Molecular Weight | 242.23 g/mol |
| Exact Mass | 242.05790880 g/mol |
| Topological Polar Surface Area (TPSA) | 55.80 Ų |
| XlogP | 2.60 |
| 141766-17-8 |
| DTXSID60707301 |
| 5-HYDROXY-2-METHOXY-9H-XANTHEN-9-ONE |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.18% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 97.76% | 95.56% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 95.19% | 94.00% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 94.37% | 99.23% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 93.50% | 99.15% |
| CHEMBL2581 | P07339 | Cathepsin D | 93.01% | 98.95% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 92.69% | 93.99% |
| CHEMBL2535 | P11166 | Glucose transporter | 91.98% | 98.75% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 89.84% | 94.73% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 88.26% | 93.31% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.63% | 89.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.22% | 86.33% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 83.56% | 93.65% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 83.47% | 99.17% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 83.23% | 92.62% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 82.03% | 91.49% |
| CHEMBL2146302 | O94925 | Glutaminase kidney isoform, mitochondrial | 81.43% | 100.00% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 81.10% | 95.50% |
| CHEMBL2095172 | P14867 | GABA-A receptor; alpha-1/beta-2/gamma-2 | 80.68% | 92.67% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 80.42% | 94.45% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Hypericum hookerianum |
| Hypericum roeperianum |
| PubChem | 53873221 |
| LOTUS | LTS0044886 |
| wikiData | Q82641034 |