5-Hydroxy-2-[2-(2-hydroxyphenyl)ethyl]-6-methoxychromen-4-one
Internal ID | 6eed1443-709e-4630-b6f9-37e2e7b7f03f |
Taxonomy | Organoheterocyclic compounds > Benzopyrans > 1-benzopyrans > Chromones |
IUPAC Name | 5-hydroxy-2-[2-(2-hydroxyphenyl)ethyl]-6-methoxychromen-4-one |
SMILES (Canonical) | COC1=C(C2=C(C=C1)OC(=CC2=O)CCC3=CC=CC=C3O)O |
SMILES (Isomeric) | COC1=C(C2=C(C=C1)OC(=CC2=O)CCC3=CC=CC=C3O)O |
InChI | InChI=1S/C18H16O5/c1-22-16-9-8-15-17(18(16)21)14(20)10-12(23-15)7-6-11-4-2-3-5-13(11)19/h2-5,8-10,19,21H,6-7H2,1H3 |
InChI Key | QIBJIVBKBQPTTD-UHFFFAOYSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C18H16O5 |
Molecular Weight | 312.30 g/mol |
Exact Mass | 312.09977361 g/mol |
Topological Polar Surface Area (TPSA) | 76.00 Ų |
XlogP | 3.60 |
There are no found synonyms. |
![2D Structure of 5-Hydroxy-2-[2-(2-hydroxyphenyl)ethyl]-6-methoxychromen-4-one 2D Structure of 5-Hydroxy-2-[2-(2-hydroxyphenyl)ethyl]-6-methoxychromen-4-one](https://plantaedb.com/storage/docs/compounds/2023/11/5-hydroxy-2-2-2-hydroxyphenylethyl-6-methoxychromen-4-one.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.52% | 91.11% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 95.75% | 86.33% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 94.50% | 94.00% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 94.42% | 93.99% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.03% | 95.56% |
CHEMBL2581 | P07339 | Cathepsin D | 93.19% | 98.95% |
CHEMBL1255126 | O15151 | Protein Mdm4 | 90.87% | 90.20% |
CHEMBL3401 | O75469 | Pregnane X receptor | 89.75% | 94.73% |
CHEMBL2535 | P11166 | Glucose transporter | 85.89% | 98.75% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.84% | 89.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 83.55% | 99.17% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 83.18% | 95.50% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 82.43% | 92.62% |
CHEMBL3194 | P02766 | Transthyretin | 82.03% | 90.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Bothriochloa ischaemum |
PubChem | 11098988 |
LOTUS | LTS0130066 |
wikiData | Q105221285 |