5-Hydroxy-1,3-dimethoxyxanthone
| Internal ID | 0e82257e-762e-4662-9ce5-62cf511879e1 |
| Taxonomy | Organoheterocyclic compounds > Benzopyrans > 1-benzopyrans > Xanthones |
| IUPAC Name | 5-hydroxy-1,3-dimethoxyxanthen-9-one |
| SMILES (Canonical) | COC1=CC2=C(C(=C1)OC)C(=O)C3=C(O2)C(=CC=C3)O |
| SMILES (Isomeric) | COC1=CC2=C(C(=C1)OC)C(=O)C3=C(O2)C(=CC=C3)O |
| InChI | InChI=1S/C15H12O5/c1-18-8-6-11(19-2)13-12(7-8)20-15-9(14(13)17)4-3-5-10(15)16/h3-7,16H,1-2H3 |
| InChI Key | PAWPPMMKSKJGQV-UHFFFAOYSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C15H12O5 |
| Molecular Weight | 272.25 g/mol |
| Exact Mass | 272.06847348 g/mol |
| Topological Polar Surface Area (TPSA) | 65.00 Ų |
| XlogP | 2.50 |
| NSC661738 |
| 5-Hydroxy-1,3-dimethoxy-9H-xanthen-9-one |
| CHEMBL3814052 |
| NSC-661738 |
| 5-hydroxy-1,3-dimethoxy-xanthen-9-one |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.92% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 97.89% | 95.56% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 96.87% | 93.99% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 96.00% | 94.00% |
| CHEMBL2535 | P11166 | Glucose transporter | 93.17% | 98.75% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 92.72% | 89.00% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 92.67% | 85.14% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 91.96% | 99.15% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 91.57% | 99.23% |
| CHEMBL2581 | P07339 | Cathepsin D | 91.11% | 98.95% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 89.25% | 94.73% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.68% | 86.33% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 87.28% | 93.31% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.34% | 94.45% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 85.55% | 92.62% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 84.48% | 95.50% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.53% | 95.89% |
| CHEMBL2146302 | O94925 | Glutaminase kidney isoform, mitochondrial | 81.38% | 100.00% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 80.24% | 99.17% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Haploclathra paniculata |
| Kielmeyera rupestris |
| Kielmeyera speciosa |
| Mammea siamensis |
| Mesua thwaitesii |
| PubChem | 378687 |
| LOTUS | LTS0056391 |
| wikiData | Q105204904 |