5-Heneicosenylresorcinol
Internal ID | 58043ed1-0737-43bd-aa39-32c2ada455c8 |
Taxonomy | Benzenoids > Phenols > Benzenediols > Resorcinols |
IUPAC Name | 5-henicos-1-enylbenzene-1,3-diol |
SMILES (Canonical) | CCCCCCCCCCCCCCCCCCCC=CC1=CC(=CC(=C1)O)O |
SMILES (Isomeric) | CCCCCCCCCCCCCCCCCCCC=CC1=CC(=CC(=C1)O)O |
InChI | InChI=1S/C27H46O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-25-22-26(28)24-27(29)23-25/h20-24,28-29H,2-19H2,1H3 |
InChI Key | AGPCTJAQZVDMOF-UHFFFAOYSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C27H46O2 |
Molecular Weight | 402.70 g/mol |
Exact Mass | 402.349780706 g/mol |
Topological Polar Surface Area (TPSA) | 40.50 Ų |
XlogP | 11.90 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 96.86% | 99.17% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.04% | 91.11% |
CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 95.21% | 92.08% |
CHEMBL2581 | P07339 | Cathepsin D | 95.01% | 98.95% |
CHEMBL230 | P35354 | Cyclooxygenase-2 | 93.09% | 89.63% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 91.12% | 96.95% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 90.94% | 91.71% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.80% | 96.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.31% | 86.33% |
CHEMBL3401 | O75469 | Pregnane X receptor | 89.47% | 94.73% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 87.24% | 91.49% |
CHEMBL240 | Q12809 | HERG | 86.92% | 89.76% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 86.85% | 96.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.13% | 95.56% |
CHEMBL215 | P09917 | Arachidonate 5-lipoxygenase | 83.83% | 92.68% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 83.81% | 97.21% |
CHEMBL242 | Q92731 | Estrogen receptor beta | 80.59% | 98.35% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Triticum aestivum |
PubChem | 129846337 |
LOTUS | LTS0172413 |
wikiData | Q104911922 |