5-Ethyl-2-methoxyphenol
| Internal ID | a0077700-5c5a-4189-ae29-a1bf8d968358 |
| Taxonomy | Benzenoids > Phenols > Methoxyphenols |
| IUPAC Name | 5-ethyl-2-methoxyphenol |
| SMILES (Canonical) | CCC1=CC(=C(C=C1)OC)O |
| SMILES (Isomeric) | CCC1=CC(=C(C=C1)OC)O |
| InChI | InChI=1S/C9H12O2/c1-3-7-4-5-9(11-2)8(10)6-7/h4-6,10H,3H2,1-2H3 |
| InChI Key | CAWZFQGJUGEKFU-UHFFFAOYSA-N |
| Popularity | 40 references in papers |
| Molecular Formula | C9H12O2 |
| Molecular Weight | 152.19 g/mol |
| Exact Mass | 152.083729621 g/mol |
| Topological Polar Surface Area (TPSA) | 29.50 Ų |
| XlogP | 1.70 |
| 2785-88-8 |
| Locustol |
| Phenol, 5-ethyl-2-methoxy- |
| G8V5WHB17K |
| UNII-G8V5WHB17K |
| 5-ETHYLGUAIACOL |
| 2-Methoxy-5-ethylphenol |
| 5-ethyl-2-methoxy-phenol |
| GUAIACOL, 5-ETHYL- |
| SCHEMBL109505 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.09% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 91.98% | 98.95% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 89.76% | 94.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.24% | 86.33% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 87.90% | 96.95% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.90% | 94.45% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 87.63% | 99.17% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 87.55% | 90.20% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 86.17% | 90.00% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 85.86% | 90.24% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 85.21% | 91.11% |
| CHEMBL2535 | P11166 | Glucose transporter | 85.10% | 98.75% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.09% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Capsicum annuum |
| Coffea arabica |
| PubChem | 3083782 |
| LOTUS | LTS0112428 |
| wikiData | Q27278942 |