5-Ethoxy-sorgoleone
Internal ID | 8024a185-6cfa-4f6d-a086-7500556e3d3c |
Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbonyl compounds > Benzoquinones > P-benzoquinones |
IUPAC Name | 5-ethoxy-2-hydroxy-3-[(8Z,11Z)-pentadeca-8,11,14-trienyl]cyclohexa-2,5-diene-1,4-dione |
SMILES (Canonical) | CCOC1=CC(=O)C(=C(C1=O)CCCCCCCC=CCC=CCC=C)O |
SMILES (Isomeric) | CCOC1=CC(=O)C(=C(C1=O)CCCCCCC/C=C\C/C=C\CC=C)O |
InChI | InChI=1S/C23H32O4/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-19-22(25)20(24)18-21(23(19)26)27-4-2/h3,6-7,9-10,18,25H,1,4-5,8,11-17H2,2H3/b7-6-,10-9- |
InChI Key | TZHMUUDTNYTFMW-HZJYTTRNSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C23H32O4 |
Molecular Weight | 372.50 g/mol |
Exact Mass | 372.23005950 g/mol |
Topological Polar Surface Area (TPSA) | 63.60 Ų |
XlogP | 6.40 |
CHEMBL516568 |
DTXSID401125867 |
210708-13-7 |
5-Ethoxy-2-hydroxy-3-(8Z,11Z)-8,11,14-pentadecatrien-1-yl-2,5-cyclohexadiene-1,4-dione |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 96.78% | 98.95% |
CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] | 94.69% | 83.57% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 93.58% | 99.17% |
CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 91.77% | 89.34% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 90.82% | 94.75% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 89.78% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 89.20% | 96.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.53% | 86.33% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.07% | 95.56% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 86.54% | 97.21% |
CHEMBL215 | P09917 | Arachidonate 5-lipoxygenase | 86.48% | 92.68% |
CHEMBL3401 | O75469 | Pregnane X receptor | 85.42% | 94.73% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.73% | 89.00% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 84.51% | 96.00% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 83.27% | 99.23% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 81.98% | 94.45% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 80.55% | 94.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Sorghum bicolor |
PubChem | 10667016 |
LOTUS | LTS0127880 |
wikiData | Q105268175 |