5-[Amino(carboxy)methyl]-2-hydroxybenzoic acid
| Internal ID | 1139bdb1-866d-4c44-947b-35ff68dc0808 |
| Taxonomy | Benzenoids > Benzene and substituted derivatives > Benzoic acids and derivatives > Salicylic acid and derivatives > Salicylic acids |
| IUPAC Name | 5-[amino(carboxy)methyl]-2-hydroxybenzoic acid |
| SMILES (Canonical) | C1=CC(=C(C=C1C(C(=O)O)N)C(=O)O)O |
| SMILES (Isomeric) | C1=CC(=C(C=C1C(C(=O)O)N)C(=O)O)O |
| InChI | InChI=1S/C9H9NO5/c10-7(9(14)15)4-1-2-6(11)5(3-4)8(12)13/h1-3,7,11H,10H2,(H,12,13)(H,14,15) |
| InChI Key | CHZBCZTXSTWCIG-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C9H9NO5 |
| Molecular Weight | 211.17 g/mol |
| Exact Mass | 211.04807239 g/mol |
| Topological Polar Surface Area (TPSA) | 121.00 Ų |
| XlogP | -1.20 |
| (RS)-3-CARBOXY-4-HYDROXYPHENYLGLYCINE |
| 5-[amino(carboxy)methyl]-2-hydroxybenzoic acid |
| alpha-Amino-3-carboxy-4-hydroxybenzeneacetic acid |
| 5-(Amino(carboxy)methyl)-2-hydroxybenzoic acid |
| L-(3-Carboxy-4-hydroxyphenyl)glycine |
| SCHEMBL1512886 |
| CHEBI:93840 |
| HMS3266G11 |
| HMS3266G13 |
| BRD-A30395175-001-01-2 |
| There are more than 10 synonyms. If you wish to see them all click here. |
![2D Structure of 5-[Amino(carboxy)methyl]-2-hydroxybenzoic acid](https://plantaedb.com/storage/docs/compounds/2023/11/5-aminocarboxymethyl-2-hydroxybenzoic-acid.jpg "2D Structure of 5-[Amino(carboxy)methyl]-2-hydroxybenzoic acid")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 99.49% | 83.82% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.70% | 91.11% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 93.97% | 99.15% |
| CHEMBL3194 | P02766 | Transthyretin | 90.21% | 90.71% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.02% | 95.56% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 87.87% | 96.09% |
| CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 86.97% | 94.42% |
| CHEMBL2581 | P07339 | Cathepsin D | 85.22% | 98.95% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 84.13% | 90.71% |
| CHEMBL1811 | P34995 | Prostanoid EP1 receptor | 83.44% | 95.71% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 82.81% | 94.45% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 81.41% | 99.17% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 80.56% | 94.62% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 80.30% | 93.56% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Caylusea abyssinica |
| Reseda luteola |
| PubChem | 4014619 |
| LOTUS | LTS0022054 |
| wikiData | Q27165576 |