5-(7-hydroxy-3,4-dihydro-2H-chromen-2-yl)-3,4-bis(3-methylbut-2-enyl)benzene-1,2-diol
| Internal ID | ddf2be8b-aa34-4635-9fa9-9e70af8009f4 |
| Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavans > 2-prenylated flavans |
| IUPAC Name | 5-(7-hydroxy-3,4-dihydro-2H-chromen-2-yl)-3,4-bis(3-methylbut-2-enyl)benzene-1,2-diol |
| SMILES (Canonical) | CC(=CCC1=C(C(=C(C=C1C2CCC3=C(O2)C=C(C=C3)O)O)O)CC=C(C)C)C |
| SMILES (Isomeric) | CC(=CCC1=C(C(=C(C=C1C2CCC3=C(O2)C=C(C=C3)O)O)O)CC=C(C)C)C |
| InChI | InChI=1S/C25H30O4/c1-15(2)5-10-19-20(11-6-16(3)4)25(28)22(27)14-21(19)23-12-8-17-7-9-18(26)13-24(17)29-23/h5-7,9,13-14,23,26-28H,8,10-12H2,1-4H3 |
| InChI Key | AOUGZVKCLQLQNU-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C25H30O4 |
| Molecular Weight | 394.50 g/mol |
| Exact Mass | 394.21440943 g/mol |
| Topological Polar Surface Area (TPSA) | 69.90 Ų |
| XlogP | 6.60 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.63% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.31% | 96.09% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.15% | 94.45% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 89.34% | 95.89% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 89.15% | 100.00% |
| CHEMBL2581 | P07339 | Cathepsin D | 88.10% | 98.95% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 86.92% | 99.17% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 86.78% | 95.89% |
| CHEMBL3038469 | P24941 | CDK2/Cyclin A | 86.17% | 91.38% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 85.78% | 97.09% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 85.34% | 94.73% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 85.18% | 93.40% |
| CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 83.86% | 91.79% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 83.73% | 92.94% |
| CHEMBL217 | P14416 | Dopamine D2 receptor | 83.59% | 95.62% |
| CHEMBL5852 | Q96P65 | Pyroglutamylated RFamide peptide receptor | 82.98% | 85.00% |
| CHEMBL4581 | P52732 | Kinesin-like protein 1 | 80.82% | 93.18% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Broussonetia papyrifera |
| PubChem | 75238697 |
| LOTUS | LTS0093799 |
| wikiData | Q104915947 |