[5-[5-[4-(3-methylbutanoyloxy)but-1-ynyl]thiophen-2-yl]thiophen-2-yl]methyl (E)-2-methylbut-2-enoate
| Internal ID | 0f79cdac-2492-4a00-a5c9-2b4e75bcb881 |
| Taxonomy | Organoheterocyclic compounds > Bi- and oligothiophenes |
| IUPAC Name | [5-[5-[4-(3-methylbutanoyloxy)but-1-ynyl]thiophen-2-yl]thiophen-2-yl]methyl (E)-2-methylbut-2-enoate |
| SMILES (Canonical) | CC=C(C)C(=O)OCC1=CC=C(S1)C2=CC=C(S2)C#CCCOC(=O)CC(C)C |
| SMILES (Isomeric) | C/C=C(\C)/C(=O)OCC1=CC=C(S1)C2=CC=C(S2)C#CCCOC(=O)CC(C)C |
| InChI | InChI=1S/C23H26O4S2/c1-5-17(4)23(25)27-15-19-10-12-21(29-19)20-11-9-18(28-20)8-6-7-13-26-22(24)14-16(2)3/h5,9-12,16H,7,13-15H2,1-4H3/b17-5+ |
| InChI Key | XJVZTVNLNRBKPZ-YAXRCOADSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C23H26O4S2 |
| Molecular Weight | 430.60 g/mol |
| Exact Mass | 430.12725165 g/mol |
| Topological Polar Surface Area (TPSA) | 109.00 Ų |
| XlogP | 5.70 |
| There are no found synonyms. |
![2D Structure of [5-[5-[4-(3-methylbutanoyloxy)but-1-ynyl]thiophen-2-yl]thiophen-2-yl]methyl (E)-2-methylbut-2-enoate](https://plantaedb.com/storage/docs/compounds/2023/11/5-5-4-3-methylbutanoyloxybut-1-ynylthiophen-2-ylthiophen-2-ylmethyl-e-2-methylbut-2-enoate.jpg "2D Structure of [5-[5-[4-(3-methylbutanoyloxy)but-1-ynyl]thiophen-2-yl]thiophen-2-yl]methyl (E)-2-methylbut-2-enoate")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.02% | 96.09% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 93.89% | 94.73% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 90.93% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 90.40% | 98.95% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 89.66% | 99.17% |
| CHEMBL3975 | P09467 | Fructose-1,6-bisphosphatase | 86.37% | 92.95% |
| CHEMBL5852 | Q96P65 | Pyroglutamylated RFamide peptide receptor | 85.07% | 85.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.78% | 86.33% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 84.67% | 90.17% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 84.38% | 94.62% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 83.81% | 94.45% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 83.78% | 95.93% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.77% | 89.00% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 80.03% | 96.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Eclipta prostrata |
| PubChem | 14539997 |
| LOTUS | LTS0170762 |
| wikiData | Q105329259 |