5-(4-Methoxyphenyl)-2-(2-phenylethenyl)-4,5-dihydro-1,3-oxazole
| Internal ID | e960793d-259c-490b-ae13-c4ab9d3cdd04 |
| Taxonomy | Benzenoids > Phenol ethers > Anisoles |
| IUPAC Name | 5-(4-methoxyphenyl)-2-(2-phenylethenyl)-4,5-dihydro-1,3-oxazole |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C18H17NO2/c1-20-16-10-8-15(9-11-16)17-13-19-18(21-17)12-7-14-5-3-2-4-6-14/h2-12,17H,13H2,1H3 |
| InChI Key | JWIXCXBFPMKPIN-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C18H17NO2 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.125928785 g/mol |
| Topological Polar Surface Area (TPSA) | 30.80 Ų |
| XlogP | 3.40 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL240 | Q12809 | HERG | 97.27% | 89.76% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 97.19% | 93.99% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.65% | 95.56% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 94.26% | 96.00% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.74% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.33% | 96.09% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 90.29% | 90.17% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.94% | 97.09% |
| CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 89.04% | 94.08% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.61% | 86.33% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 83.85% | 94.73% |
| CHEMBL2716 | Q8WUI4 | Histone deacetylase 7 | 83.62% | 89.44% |
| CHEMBL2039 | P27338 | Monoamine oxidase B | 83.24% | 92.51% |
| CHEMBL1907599 | P05556 | Integrin alpha-4/beta-1 | 82.45% | 92.86% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Aegle marmelos |
| PubChem | 74433641 |
| LOTUS | LTS0106286 |
| wikiData | Q105136182 |