5-[2-(4-Hydroxyphenyl)ethenyl]-2-(3-methylbut-1-enyl)benzene-1,3-diol
Internal ID | 314c680d-6a1c-41a9-acfc-a94dfb5a8481 |
Taxonomy | Phenylpropanoids and polyketides > Stilbenes |
IUPAC Name | 5-[2-(4-hydroxyphenyl)ethenyl]-2-(3-methylbut-1-enyl)benzene-1,3-diol |
SMILES (Canonical) | CC(C)C=CC1=C(C=C(C=C1O)C=CC2=CC=C(C=C2)O)O |
SMILES (Isomeric) | CC(C)C=CC1=C(C=C(C=C1O)C=CC2=CC=C(C=C2)O)O |
InChI | InChI=1S/C19H20O3/c1-13(2)3-10-17-18(21)11-15(12-19(17)22)5-4-14-6-8-16(20)9-7-14/h3-13,20-22H,1-2H3 |
InChI Key | XTDKVQYWANHUFS-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C19H20O3 |
Molecular Weight | 296.40 g/mol |
Exact Mass | 296.14124450 g/mol |
Topological Polar Surface Area (TPSA) | 60.70 Ų |
XlogP | 4.90 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL242 | Q92731 | Estrogen receptor beta | 95.47% | 98.35% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.40% | 95.56% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.16% | 91.11% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 92.44% | 96.00% |
CHEMBL2581 | P07339 | Cathepsin D | 91.46% | 98.95% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 89.89% | 93.99% |
CHEMBL3194 | P02766 | Transthyretin | 89.00% | 90.71% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 88.39% | 91.49% |
CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 88.25% | 93.10% |
CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 86.95% | 97.23% |
CHEMBL3401 | O75469 | Pregnane X receptor | 85.77% | 94.73% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 84.03% | 99.15% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 83.51% | 89.62% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 82.43% | 94.45% |
CHEMBL2093869 | P05106 | Integrin alpha-IIb/beta-3 | 82.19% | 95.42% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.45% | 89.00% |
CHEMBL3830 | Q2M2I8 | Adaptor-associated kinase | 81.40% | 83.10% |
CHEMBL1907599 | P05556 | Integrin alpha-4/beta-1 | 80.48% | 92.86% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Arachis hypogaea |
Rivina humilis |
PubChem | 72824777 |
LOTUS | LTS0217889 |
wikiData | Q105246173 |