5-[(1R,2R)-2-(2,6-dimethoxy-4-prop-2-enylphenoxy)-1-hydroxypropyl]-2,3-dimethoxyphenol
Internal ID | 2c168931-836e-43b6-9a03-ea10f6ff5c86 |
Taxonomy | Lignans, neolignans and related compounds |
IUPAC Name | 5-[(1R,2R)-2-(2,6-dimethoxy-4-prop-2-enylphenoxy)-1-hydroxypropyl]-2,3-dimethoxyphenol |
SMILES (Canonical) | CC(C(C1=CC(=C(C(=C1)OC)OC)O)O)OC2=C(C=C(C=C2OC)CC=C)OC |
SMILES (Isomeric) | C[C@H]([C@@H](C1=CC(=C(C(=C1)OC)OC)O)O)OC2=C(C=C(C=C2OC)CC=C)OC |
InChI | InChI=1S/C22H28O7/c1-7-8-14-9-17(25-3)22(18(10-14)26-4)29-13(2)20(24)15-11-16(23)21(28-6)19(12-15)27-5/h7,9-13,20,23-24H,1,8H2,2-6H3/t13-,20+/m1/s1 |
InChI Key | FIUKDYRAJAEJPH-XCLFUZPHSA-N |
Popularity | 0 references in papers |
Molecular Formula | C22H28O7 |
Molecular Weight | 404.50 g/mol |
Exact Mass | 404.18350323 g/mol |
Topological Polar Surface Area (TPSA) | 86.60 Ų |
XlogP | 3.80 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.89% | 96.09% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 95.74% | 85.14% |
CHEMBL2581 | P07339 | Cathepsin D | 94.59% | 98.95% |
CHEMBL1255126 | O15151 | Protein Mdm4 | 93.28% | 90.20% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.70% | 91.11% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 92.33% | 99.17% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.93% | 94.45% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 88.83% | 89.62% |
CHEMBL4208 | P20618 | Proteasome component C5 | 88.31% | 90.00% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 86.82% | 95.89% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 82.91% | 91.07% |
CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 82.15% | 89.50% |
CHEMBL2535 | P11166 | Glucose transporter | 81.91% | 98.75% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 80.67% | 86.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Myristica fragrans |
PubChem | 162879156 |
LOTUS | LTS0083044 |
wikiData | Q104995883 |