[(4S,6E,8S,10R)-8-acetyloxy-10-hydroxy-2,6,10-trimethyldodeca-2,6,11-trien-4-yl] acetate
| Internal ID | 0b58c789-ef9a-48a3-8df4-0fdcb6050817 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids |
| IUPAC Name | [(4S,6E,8S,10R)-8-acetyloxy-10-hydroxy-2,6,10-trimethyldodeca-2,6,11-trien-4-yl] acetate |
| SMILES (Canonical) | CC(=CC(CC(=CC(CC(C)(C=C)O)OC(=O)C)C)OC(=O)C)C |
| SMILES (Isomeric) | CC(=C[C@H](C/C(=C/[C@H](C[C@](C)(C=C)O)OC(=O)C)/C)OC(=O)C)C |
| InChI | InChI=1S/C19H30O5/c1-8-19(7,22)12-18(24-16(6)21)11-14(4)10-17(9-13(2)3)23-15(5)20/h8-9,11,17-18,22H,1,10,12H2,2-7H3/b14-11+/t17-,18-,19+/m1/s1 |
| InChI Key | ZWCHRIPZSGWZAL-LBKPJZIZSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C19H30O5 |
| Molecular Weight | 338.40 g/mol |
| Exact Mass | 338.20932405 g/mol |
| Topological Polar Surface Area (TPSA) | 72.80 Ų |
| XlogP | 3.50 |
| There are no found synonyms. |
![2D Structure of [(4S,6E,8S,10R)-8-acetyloxy-10-hydroxy-2,6,10-trimethyldodeca-2,6,11-trien-4-yl] acetate](https://plantaedb.com/storage/docs/compounds/2023/11/4s6e8s10r-8-acetyloxy-10-hydroxy-2610-trimethyldodeca-2611-trien-4-yl-acetate.jpg "2D Structure of [(4S,6E,8S,10R)-8-acetyloxy-10-hydroxy-2,6,10-trimethyldodeca-2,6,11-trien-4-yl] acetate")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5966 | P55899 | IgG receptor FcRn large subunit p51 | 95.01% | 90.93% |
| CHEMBL2581 | P07339 | Cathepsin D | 94.97% | 98.95% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 93.00% | 97.21% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 92.68% | 96.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.15% | 96.09% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 91.71% | 83.82% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.40% | 99.17% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 87.68% | 85.14% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 86.05% | 94.73% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 84.61% | 94.45% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 83.40% | 93.56% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Achillea nobilis |
| Santolina oblongifolia |
| PubChem | 14707122 |
| LOTUS | LTS0096641 |
| wikiData | Q105384818 |