(4S)-1'-methylspiro[1,2-dihydro-3,1-benzoxazine-4,3'-pyrrolidine]-2'-one
| Internal ID | 339ffa2c-e55b-469c-8194-c9a0b6245c68 |
| Taxonomy | Organoheterocyclic compounds > Benzoxazines |
| IUPAC Name | (4S)-1'-methylspiro[1,2-dihydro-3,1-benzoxazine-4,3'-pyrrolidine]-2'-one |
| SMILES (Canonical) | CN1CCC2(C1=O)C3=CC=CC=C3NCO2 |
| SMILES (Isomeric) | CN1CC[C@@]2(C1=O)C3=CC=CC=C3NCO2 |
| InChI | InChI=1S/C12H14N2O2/c1-14-7-6-12(11(14)15)9-4-2-3-5-10(9)13-8-16-12/h2-5,13H,6-8H2,1H3/t12-/m0/s1 |
| InChI Key | RNJHBYURUYSBJY-LBPRGKRZSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C12H14N2O2 |
| Molecular Weight | 218.25 g/mol |
| Exact Mass | 218.105527694 g/mol |
| Topological Polar Surface Area (TPSA) | 41.60 Ų |
| XlogP | 1.10 |
| There are no found synonyms. |
![2D Structure of (4S)-1'-methylspiro[1,2-dihydro-3,1-benzoxazine-4,3'-pyrrolidine]-2'-one](https://plantaedb.com/storage/docs/compounds/2023/11/4s-1-methylspiro12-dihydro-31-benzoxazine-43-pyrrolidine-2-one.jpg "2D Structure of (4S)-1'-methylspiro[1,2-dihydro-3,1-benzoxazine-4,3'-pyrrolidine]-2'-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 97.65% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.06% | 96.09% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 92.77% | 90.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.61% | 95.56% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 91.45% | 91.11% |
| CHEMBL3524 | P56524 | Histone deacetylase 4 | 91.37% | 92.97% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 89.83% | 93.40% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 88.41% | 98.59% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.57% | 86.33% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 84.98% | 93.65% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 82.72% | 99.23% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 81.67% | 94.00% |
| CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 80.93% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Arundo donax |
| PubChem | 163060351 |
| LOTUS | LTS0066461 |
| wikiData | Q105241420 |