4H-1-Benzopyran-4-one, 7-(beta-D-glucopyranosyloxy)-3-(4-hydroxyphenyl)-
Internal ID | d3a393b3-74f5-4c43-87d0-97487751b9c1 |
Taxonomy | Phenylpropanoids and polyketides > Isoflavonoids > Isoflavonoid O-glycosides |
IUPAC Name | 3-(4-hydroxyphenyl)-7-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-4-one |
SMILES (Canonical) | C1=CC(=CC=C1C2=COC3=C(C2=O)C=CC(=C3)OC4C(C(C(C(O4)CO)O)O)O)O |
SMILES (Isomeric) | C1=CC(=CC=C1C2=COC3=C(C2=O)C=CC(=C3)OC4C(C(C(C(O4)CO)O)O)O)O |
InChI | InChI=1S/C21H20O9/c22-8-16-18(25)19(26)20(27)21(30-16)29-12-5-6-13-15(7-12)28-9-14(17(13)24)10-1-3-11(23)4-2-10/h1-7,9,16,18-23,25-27H,8H2 |
InChI Key | KYQZWONCHDNPDP-UHFFFAOYSA-N |
Popularity | 7 references in papers |
Molecular Formula | C21H20O9 |
Molecular Weight | 416.40 g/mol |
Exact Mass | 416.11073221 g/mol |
Topological Polar Surface Area (TPSA) | 146.00 Ų |
XlogP | 0.70 |
CHEMBL115316 |
SCHEMBL3423674 |
Isoflavone base + 2O, O-Hex |
KYQZWONCHDNPDP-UHFFFAOYSA-N |
Daidzoside;Daidzein 7-O-glucoside |
HMS2194K16 |
HMS3348J07 |
HMS3604G15 |
BCP11504 |
AKOS024284500 |
There are more than 10 synonyms. If you wish to see them all click here. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.41% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 96.43% | 98.95% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 95.21% | 89.00% |
CHEMBL242 | Q92731 | Estrogen receptor beta | 93.36% | 98.35% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 93.20% | 94.00% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 92.48% | 99.15% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 92.07% | 86.92% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.97% | 99.17% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.28% | 97.09% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 89.93% | 95.78% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 89.81% | 91.71% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 88.97% | 96.21% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.18% | 86.33% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.87% | 95.56% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 83.80% | 95.89% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.33% | 95.89% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 83.29% | 95.93% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 81.72% | 96.09% |
CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 80.76% | 97.28% |
CHEMBL3401 | O75469 | Pregnane X receptor | 80.69% | 94.73% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 80.27% | 91.49% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 80.02% | 96.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
PubChem | 4183640 |
LOTUS | LTS0156881 |
wikiData | Q105147884 |